About 2-methylpent-2-enamide;morpholine
2-methylpent-2-enamide;morpholine (PubChem CID 66895956) has the molecular formula C10H20N2O2
and a molecular weight of 200.28 g/mol. Its IUPAC name is 2-methylpent-2-enamide;morpholine.
Molecular Properties
| Compound Name | 2-methylpent-2-enamide;morpholine |
| PubChem CID | 66895956 |
| Molecular Formula | C10H20N2O2 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.15 |
| IUPAC Name | 2-methylpent-2-enamide;morpholine |
| SMILES | C1COCCN1.CCC=C(C)C(N)=O |
| InChI | InChI=1S/C6H11NO.C4H9NO/c1-3-4-5(2)6(7)8;1-3-6-4-2-5-1/h4H,3H2,1-2H3,(H2,7,8);5H,1-4H2 |
| InChIKey | SHZWJAQAUDVROT-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-methylpent-2-enamide;morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpent-2-enamide;morpholine?
The IUPAC name of 2-methylpent-2-enamide;morpholine (CID 66895956) is 2-methylpent-2-enamide;morpholine.
What is the SMILES notation for 2-methylpent-2-enamide;morpholine?
The canonical SMILES for 2-methylpent-2-enamide;morpholine is C1COCCN1.CCC=C(C)C(N)=O.
What is the InChIKey of 2-methylpent-2-enamide;morpholine?
The InChIKey is SHZWJAQAUDVROT-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11NO.C4H9NO/c1-3-4-5(2)6(7)8;1-3-6-4-2-5-1/h4H,3H2,1-2H3,(H2,7,8);5H,1-4H2.
What are the key properties of 2-methylpent-2-enamide;morpholine?
2-methylpent-2-enamide;morpholine has a molecular weight of 200.28 g/mol, XLogP of 0.43, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpent-2-enamide;morpholine is sourced from PubChem (CID 66895956), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).