About tert-butyl N-cyclopropyl-N-[[2,3-dichloro-5-(hydroxymethyl)phenyl]methyl]carbamate
tert-butyl N-cyclopropyl-N-[[2,3-dichloro-5-(hydroxymethyl)phenyl]methyl]carbamate (PubChem CID 66896138) has the molecular formula C16H21Cl2NO3
and a molecular weight of 346.25 g/mol. Its IUPAC name is tert-butyl N-cyclopropyl-N-[[2,3-dichloro-5-(hydroxymethyl)phenyl]methyl]carbamate.
Molecular Properties
| Compound Name | tert-butyl N-cyclopropyl-N-[[2,3-dichloro-5-(hydroxymethyl)phenyl]methyl]carbamate |
| PubChem CID | 66896138 |
| Molecular Formula | C16H21Cl2NO3 |
| Molecular Weight | 346.25 g/mol |
| Exact Mass | 345.09 |
| IUPAC Name | tert-butyl N-cyclopropyl-N-[[2,3-dichloro-5-(hydroxymethyl)phenyl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N(Cc1cc(CO)cc(Cl)c1Cl)C1CC1 |
| InChI | InChI=1S/C16H21Cl2NO3/c1-16(2,3)22-15(21)19(12-4-5-12)8-11-6-10(9-20)7-13(17)14(11)18/h6-7,12,20H,4-5,8-9H2,1-3H3 |
| InChIKey | MIQHILZLGPBXQF-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.25 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze tert-butyl N-cyclopropyl-N-[[2,3-dichloro-5-(hydroxymethyl)phenyl]methyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-cyclopropyl-N-[[2,3-dichloro-5-(hydroxymethyl)phenyl]methyl]carbamate?
The IUPAC name of tert-butyl N-cyclopropyl-N-[[2,3-dichloro-5-(hydroxymethyl)phenyl]methyl]carbamate (CID 66896138) is tert-butyl N-cyclopropyl-N-[[2,3-dichloro-5-(hydroxymethyl)phenyl]methyl]carbamate.
What is the SMILES notation for tert-butyl N-cyclopropyl-N-[[2,3-dichloro-5-(hydroxymethyl)phenyl]methyl]carbamate?
The canonical SMILES for tert-butyl N-cyclopropyl-N-[[2,3-dichloro-5-(hydroxymethyl)phenyl]methyl]carbamate is CC(C)(C)OC(=O)N(Cc1cc(CO)cc(Cl)c1Cl)C1CC1.
What is the InChIKey of tert-butyl N-cyclopropyl-N-[[2,3-dichloro-5-(hydroxymethyl)phenyl]methyl]carbamate?
The InChIKey is MIQHILZLGPBXQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H21Cl2NO3/c1-16(2,3)22-15(21)19(12-4-5-12)8-11-6-10(9-20)7-13(17)14(11)18/h6-7,12,20H,4-5,8-9H2,1-3H3.
What are the key properties of tert-butyl N-cyclopropyl-N-[[2,3-dichloro-5-(hydroxymethyl)phenyl]methyl]carbamate?
tert-butyl N-cyclopropyl-N-[[2,3-dichloro-5-(hydroxymethyl)phenyl]methyl]carbamate has a molecular weight of 346.25 g/mol, XLogP of 4.39, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-cyclopropyl-N-[[2,3-dichloro-5-(hydroxymethyl)phenyl]methyl]carbamate is sourced from PubChem (CID 66896138), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).