C26H32O2 — CID 66896163
4-[2-(5,5,8,8-tetramethyl-3-propan-2-yl-6,7-dihydronaphthalen-2-yl)ethenyl]benzoic acid (PubChem CID 66896163) has the molecular formula C26H32O2 and a molecular weight of 376.54 g/mol. Its IUPAC name is 4-[2-(5,5,8,8-tetramethyl-3-propan-2-yl-6,7-dihydronaphthalen-2-yl)ethenyl]benzoic acid.
| Compound Name | 4-[2-(5,5,8,8-tetramethyl-3-propan-2-yl-6,7-dihydronaphthalen-2-yl)ethenyl]benzoic acid |
|---|---|
| PubChem CID | 66896163 |
| Molecular Formula | C26H32O2 |
| Molecular Weight | 376.54 g/mol |
| Exact Mass | 376.24 |
| IUPAC Name | 4-[2-(5,5,8,8-tetramethyl-3-propan-2-yl-6,7-dihydronaphthalen-2-yl)ethenyl]benzoic acid |
| SMILES | CC(C)c1cc2c(cc1C=Cc1ccc(C(=O)O)cc1)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C26H32O2/c1-17(2)21-16-23-22(25(3,4)13-14-26(23,5)6)15-20(21)12-9-18-7-10-19(11-8-18)24(27)28/h7-12,15-17H,13-14H2,1-6H3,(H,27,28) |
| InChIKey | KJPMZDDULBTRAG-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.54 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|