About 3,3-dibutylhept-6-ene-2,4-diol
3,3-dibutylhept-6-ene-2,4-diol (PubChem CID 66896188) has the molecular formula C15H30O2
and a molecular weight of 242.40 g/mol. Its IUPAC name is 3,3-dibutylhept-6-ene-2,4-diol.
Molecular Properties
| Compound Name | 3,3-dibutylhept-6-ene-2,4-diol |
| PubChem CID | 66896188 |
| Molecular Formula | C15H30O2 |
| Molecular Weight | 242.40 g/mol |
| Exact Mass | 242.22 |
| IUPAC Name | 3,3-dibutylhept-6-ene-2,4-diol |
| SMILES | C=CCC(O)C(CCCC)(CCCC)C(C)O |
| InChI | InChI=1S/C15H30O2/c1-5-8-11-15(13(4)16,12-9-6-2)14(17)10-7-3/h7,13-14,16-17H,3,5-6,8-12H2,1-2,4H3 |
| InChIKey | KPJFSKLILYQGBE-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.40 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3,3-dibutylhept-6-ene-2,4-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-dibutylhept-6-ene-2,4-diol?
The IUPAC name of 3,3-dibutylhept-6-ene-2,4-diol (CID 66896188) is 3,3-dibutylhept-6-ene-2,4-diol.
What is the SMILES notation for 3,3-dibutylhept-6-ene-2,4-diol?
The canonical SMILES for 3,3-dibutylhept-6-ene-2,4-diol is C=CCC(O)C(CCCC)(CCCC)C(C)O.
What is the InChIKey of 3,3-dibutylhept-6-ene-2,4-diol?
The InChIKey is KPJFSKLILYQGBE-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H30O2/c1-5-8-11-15(13(4)16,12-9-6-2)14(17)10-7-3/h7,13-14,16-17H,3,5-6,8-12H2,1-2,4H3.
What are the key properties of 3,3-dibutylhept-6-ene-2,4-diol?
3,3-dibutylhept-6-ene-2,4-diol has a molecular weight of 242.40 g/mol, XLogP of 3.67, 10 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-dibutylhept-6-ene-2,4-diol is sourced from PubChem (CID 66896188), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).