About trans-(1R,2S)-2-ethenyl-1-(ethylamino)cyclopropane-1-carboxylic acid;hydrochloride
trans-(1R,2S)-2-ethenyl-1-(ethylamino)cyclopropane-1-carboxylic acid;hydrochloride (PubChem CID 66896321) has the molecular formula C8H14ClNO2
and a molecular weight of 191.66 g/mol. Its IUPAC name is trans-(1R,2S)-2-ethenyl-1-(ethylamino)cyclopropane-1-carboxylic acid;hydrochloride.
Molecular Properties
| Compound Name | trans-(1R,2S)-2-ethenyl-1-(ethylamino)cyclopropane-1-carboxylic acid;hydrochloride |
| PubChem CID | 66896321 |
| Molecular Formula | C8H14ClNO2 |
| Molecular Weight | 191.66 g/mol |
| Exact Mass | 191.07 |
| IUPAC Name | trans-(1R,2S)-2-ethenyl-1-(ethylamino)cyclopropane-1-carboxylic acid;hydrochloride |
| SMILES | C=C[C@@H]1C[C@]1(NCC)C(=O)O.Cl |
| InChI | InChI=1S/C8H13NO2.ClH/c1-3-6-5-8(6,7(10)11)9-4-2;/h3,6,9H,1,4-5H2,2H3,(H,10,11);1H/t6-,8-;/m1./s1 |
| InChIKey | UHDKJDQIKGELPO-CIRBGYJCSA-N |
| XLogP | 1.05 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.66 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze trans-(1R,2S)-2-ethenyl-1-(ethylamino)cyclopropane-1-carboxylic acid;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trans-(1R,2S)-2-ethenyl-1-(ethylamino)cyclopropane-1-carboxylic acid;hydrochloride?
The IUPAC name of trans-(1R,2S)-2-ethenyl-1-(ethylamino)cyclopropane-1-carboxylic acid;hydrochloride (CID 66896321) is trans-(1R,2S)-2-ethenyl-1-(ethylamino)cyclopropane-1-carboxylic acid;hydrochloride.
What is the SMILES notation for trans-(1R,2S)-2-ethenyl-1-(ethylamino)cyclopropane-1-carboxylic acid;hydrochloride?
The canonical SMILES for trans-(1R,2S)-2-ethenyl-1-(ethylamino)cyclopropane-1-carboxylic acid;hydrochloride is C=C[C@@H]1C[C@]1(NCC)C(=O)O.Cl.
What is the InChIKey of trans-(1R,2S)-2-ethenyl-1-(ethylamino)cyclopropane-1-carboxylic acid;hydrochloride?
The InChIKey is UHDKJDQIKGELPO-CIRBGYJCSA-N. The full InChI is InChI=1S/C8H13NO2.ClH/c1-3-6-5-8(6,7(10)11)9-4-2;/h3,6,9H,1,4-5H2,2H3,(H,10,11);1H/t6-,8-;/m1./s1.
What are the key properties of trans-(1R,2S)-2-ethenyl-1-(ethylamino)cyclopropane-1-carboxylic acid;hydrochloride?
trans-(1R,2S)-2-ethenyl-1-(ethylamino)cyclopropane-1-carboxylic acid;hydrochloride has a molecular weight of 191.66 g/mol, XLogP of 1.05, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for trans-(1R,2S)-2-ethenyl-1-(ethylamino)cyclopropane-1-carboxylic acid;hydrochloride is sourced from PubChem (CID 66896321), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).