About 3-[4-[3,5-di(propan-2-yl)-2-propoxyphenyl]-1-benzothiophen-2-yl]prop-2-enoic acid
3-[4-[3,5-di(propan-2-yl)-2-propoxyphenyl]-1-benzothiophen-2-yl]prop-2-enoic acid (PubChem CID 66896797) has the molecular formula C26H30O3S
and a molecular weight of 422.59 g/mol. Its IUPAC name is 3-[4-[3,5-di(propan-2-yl)-2-propoxyphenyl]-1-benzothiophen-2-yl]prop-2-enoic acid.
Molecular Properties
| Compound Name | 3-[4-[3,5-di(propan-2-yl)-2-propoxyphenyl]-1-benzothiophen-2-yl]prop-2-enoic acid |
| PubChem CID | 66896797 |
| Molecular Formula | C26H30O3S |
| Molecular Weight | 422.59 g/mol |
| Exact Mass | 422.19 |
| IUPAC Name | 3-[4-[3,5-di(propan-2-yl)-2-propoxyphenyl]-1-benzothiophen-2-yl]prop-2-enoic acid |
| SMILES | CCCOc1c(-c2cccc3sc(C=CC(=O)O)cc23)cc(C(C)C)cc1C(C)C |
| InChI | InChI=1S/C26H30O3S/c1-6-12-29-26-21(17(4)5)13-18(16(2)3)14-23(26)20-8-7-9-24-22(20)15-19(30-24)10-11-25(27)28/h7-11,13-17H,6,12H2,1-5H3,(H,27,28) |
| InChIKey | ZCFZPZYSYIUEMA-UHFFFAOYSA-N |
| XLogP | 7.70 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 422.59 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 3-[4-[3,5-di(propan-2-yl)-2-propoxyphenyl]-1-benzothiophen-2-yl]prop-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-[3,5-di(propan-2-yl)-2-propoxyphenyl]-1-benzothiophen-2-yl]prop-2-enoic acid?
The IUPAC name of 3-[4-[3,5-di(propan-2-yl)-2-propoxyphenyl]-1-benzothiophen-2-yl]prop-2-enoic acid (CID 66896797) is 3-[4-[3,5-di(propan-2-yl)-2-propoxyphenyl]-1-benzothiophen-2-yl]prop-2-enoic acid.
What is the SMILES notation for 3-[4-[3,5-di(propan-2-yl)-2-propoxyphenyl]-1-benzothiophen-2-yl]prop-2-enoic acid?
The canonical SMILES for 3-[4-[3,5-di(propan-2-yl)-2-propoxyphenyl]-1-benzothiophen-2-yl]prop-2-enoic acid is CCCOc1c(-c2cccc3sc(C=CC(=O)O)cc23)cc(C(C)C)cc1C(C)C.
What is the InChIKey of 3-[4-[3,5-di(propan-2-yl)-2-propoxyphenyl]-1-benzothiophen-2-yl]prop-2-enoic acid?
The InChIKey is ZCFZPZYSYIUEMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H30O3S/c1-6-12-29-26-21(17(4)5)13-18(16(2)3)14-23(26)20-8-7-9-24-22(20)15-19(30-24)10-11-25(27)28/h7-11,13-17H,6,12H2,1-5H3,(H,27,28).
What are the key properties of 3-[4-[3,5-di(propan-2-yl)-2-propoxyphenyl]-1-benzothiophen-2-yl]prop-2-enoic acid?
3-[4-[3,5-di(propan-2-yl)-2-propoxyphenyl]-1-benzothiophen-2-yl]prop-2-enoic acid has a molecular weight of 422.59 g/mol, XLogP of 7.70, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-[3,5-di(propan-2-yl)-2-propoxyphenyl]-1-benzothiophen-2-yl]prop-2-enoic acid is sourced from PubChem (CID 66896797), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).