About 2-methylpropyl N-cyclopropyl-N-[[2,3-dichloro-5-(2-methoxyethyl)phenyl]methyl]carbamate
2-methylpropyl N-cyclopropyl-N-[[2,3-dichloro-5-(2-methoxyethyl)phenyl]methyl]carbamate (PubChem CID 66896835) has the molecular formula C18H25Cl2NO3
and a molecular weight of 374.31 g/mol. Its IUPAC name is 2-methylpropyl N-cyclopropyl-N-[[2,3-dichloro-5-(2-methoxyethyl)phenyl]methyl]carbamate.
Molecular Properties
| Compound Name | 2-methylpropyl N-cyclopropyl-N-[[2,3-dichloro-5-(2-methoxyethyl)phenyl]methyl]carbamate |
| PubChem CID | 66896835 |
| Molecular Formula | C18H25Cl2NO3 |
| Molecular Weight | 374.31 g/mol |
| Exact Mass | 373.12 |
| IUPAC Name | 2-methylpropyl N-cyclopropyl-N-[[2,3-dichloro-5-(2-methoxyethyl)phenyl]methyl]carbamate |
| SMILES | COCCc1cc(Cl)c(Cl)c(CN(C(=O)OCC(C)C)C2CC2)c1 |
| InChI | InChI=1S/C18H25Cl2NO3/c1-12(2)11-24-18(22)21(15-4-5-15)10-14-8-13(6-7-23-3)9-16(19)17(14)20/h8-9,12,15H,4-7,10-11H2,1-3H3 |
| InChIKey | ROFDGFNFWXYHMJ-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 374.31 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-methylpropyl N-cyclopropyl-N-[[2,3-dichloro-5-(2-methoxyethyl)phenyl]methyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpropyl N-cyclopropyl-N-[[2,3-dichloro-5-(2-methoxyethyl)phenyl]methyl]carbamate?
The IUPAC name of 2-methylpropyl N-cyclopropyl-N-[[2,3-dichloro-5-(2-methoxyethyl)phenyl]methyl]carbamate (CID 66896835) is 2-methylpropyl N-cyclopropyl-N-[[2,3-dichloro-5-(2-methoxyethyl)phenyl]methyl]carbamate.
What is the SMILES notation for 2-methylpropyl N-cyclopropyl-N-[[2,3-dichloro-5-(2-methoxyethyl)phenyl]methyl]carbamate?
The canonical SMILES for 2-methylpropyl N-cyclopropyl-N-[[2,3-dichloro-5-(2-methoxyethyl)phenyl]methyl]carbamate is COCCc1cc(Cl)c(Cl)c(CN(C(=O)OCC(C)C)C2CC2)c1.
What is the InChIKey of 2-methylpropyl N-cyclopropyl-N-[[2,3-dichloro-5-(2-methoxyethyl)phenyl]methyl]carbamate?
The InChIKey is ROFDGFNFWXYHMJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H25Cl2NO3/c1-12(2)11-24-18(22)21(15-4-5-15)10-14-8-13(6-7-23-3)9-16(19)17(14)20/h8-9,12,15H,4-7,10-11H2,1-3H3.
What are the key properties of 2-methylpropyl N-cyclopropyl-N-[[2,3-dichloro-5-(2-methoxyethyl)phenyl]methyl]carbamate?
2-methylpropyl N-cyclopropyl-N-[[2,3-dichloro-5-(2-methoxyethyl)phenyl]methyl]carbamate has a molecular weight of 374.31 g/mol, XLogP of 4.94, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpropyl N-cyclopropyl-N-[[2,3-dichloro-5-(2-methoxyethyl)phenyl]methyl]carbamate is sourced from PubChem (CID 66896835), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).