C25H25F3O3S — CID 66896874
(Z)-2-[4-[3-tert-butyl-5-methyl-2-(2,2,2-trifluoroethoxy)phenyl]-1-benzothiophen-2-yl]but-2-enoic acid (PubChem CID 66896874) has the molecular formula C25H25F3O3S and a molecular weight of 462.53 g/mol. Its IUPAC name is (Z)-2-[4-[3-tert-butyl-5-methyl-2-(2,2,2-trifluoroethoxy)phenyl]-1-benzothiophen-2-yl]but-2-enoic acid.
| Compound Name | (Z)-2-[4-[3-tert-butyl-5-methyl-2-(2,2,2-trifluoroethoxy)phenyl]-1-benzothiophen-2-yl]but-2-enoic acid |
|---|---|
| PubChem CID | 66896874 |
| Molecular Formula | C25H25F3O3S |
| Molecular Weight | 462.53 g/mol |
| Exact Mass | 462.15 |
| IUPAC Name | (Z)-2-[4-[3-tert-butyl-5-methyl-2-(2,2,2-trifluoroethoxy)phenyl]-1-benzothiophen-2-yl]but-2-enoic acid |
| SMILES | C/C=C(/C(=O)O)c1cc2c(-c3cc(C)cc(C(C)(C)C)c3OCC(F)(F)F)cccc2s1 |
| InChI | InChI=1S/C25H25F3O3S/c1-6-15(23(29)30)21-12-17-16(8-7-9-20(17)32-21)18-10-14(2)11-19(24(3,4)5)22(18)31-13-25(26,27)28/h6-12H,13H2,1-5H3,(H,29,30)/b15-6+ |
| InChIKey | JRBQIVJALMEECI-GIDUJCDVSA-N |
| XLogP | 7.60 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.53 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|