C18H22N2O4S2 — CID 66897031
5,11-dipentyl-2,8-dithia-5,11-diazatricyclo[7.3.0.03,7]dodeca-1(9),3(7)-diene-4,6,10,12-tetrone (PubChem CID 66897031) has the molecular formula C18H22N2O4S2 and a molecular weight of 394.52 g/mol. Its IUPAC name is 5,11-dipentyl-2,8-dithia-5,11-diazatricyclo[7.3.0.03,7]dodeca-1(9),3(7)-diene-4,6,10,12-tetrone.
| Compound Name | 5,11-dipentyl-2,8-dithia-5,11-diazatricyclo[7.3.0.03,7]dodeca-1(9),3(7)-diene-4,6,10,12-tetrone |
|---|---|
| PubChem CID | 66897031 |
| Molecular Formula | C18H22N2O4S2 |
| Molecular Weight | 394.52 g/mol |
| Exact Mass | 394.10 |
| IUPAC Name | 5,11-dipentyl-2,8-dithia-5,11-diazatricyclo[7.3.0.03,7]dodeca-1(9),3(7)-diene-4,6,10,12-tetrone |
| SMILES | CCCCCn1c(=O)c2sc3c(=O)n(CCCCC)c(=O)c3sc2c1=O |
| InChI | InChI=1S/C18H22N2O4S2/c1-3-5-7-9-19-15(21)11-12(16(19)22)26-14-13(25-11)17(23)20(18(14)24)10-8-6-4-2/h3-10H2,1-2H3 |
| InChIKey | ZWVGVSWAQRWMEM-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 78.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.52 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|