C34H49N5O4SSi2 — CID 66897754
5-(1,1-dioxothian-4-yl)-3-(4-phenyl-3-pyridinyl)-N,N-bis(2-trimethylsilylethoxymethyl)pyrazolo[1,5-a]pyrimidin-7-amine (PubChem CID 66897754) has the molecular formula C34H49N5O4SSi2 and a molecular weight of 680.04 g/mol. Its IUPAC name is 5-(1,1-dioxothian-4-yl)-3-(4-phenyl-3-pyridinyl)-N,N-bis(2-trimethylsilylethoxymethyl)pyrazolo[1,5-a]pyrimidin-7-amine.
| Compound Name | 5-(1,1-dioxothian-4-yl)-3-(4-phenyl-3-pyridinyl)-N,N-bis(2-trimethylsilylethoxymethyl)pyrazolo[1,5-a]pyrimidin-7-amine |
|---|---|
| PubChem CID | 66897754 |
| Molecular Formula | C34H49N5O4SSi2 |
| Molecular Weight | 680.04 g/mol |
| Exact Mass | 679.30 |
| IUPAC Name | 5-(1,1-dioxothian-4-yl)-3-(4-phenyl-3-pyridinyl)-N,N-bis(2-trimethylsilylethoxymethyl)pyrazolo[1,5-a]pyrimidin-7-amine |
| SMILES | C[Si](C)(C)CCOCN(COCC[Si](C)(C)C)c1cc(C2CCS(=O)(=O)CC2)nc2c(-c3cnccc3-c3ccccc3)cnn12 |
| InChI | InChI=1S/C34H49N5O4SSi2/c1-45(2,3)20-16-42-25-38(26-43-17-21-46(4,5)6)33-22-32(28-13-18-44(40,41)19-14-28)37-34-31(24-36-39(33)34)30-23-35-15-12-29(30)27-10-8-7-9-11-27/h7-12,15,22-24,28H,13-14,16-21,25-26H2,1-6H3 |
| InChIKey | QXUMSWIKCJUYIS-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 98.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.04 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|