C36H32N5O5S+ — CID 66898003
[9-[2-carboxy-5-[3-[(2-cyano-1,3-benzothiazol-6-yl)oxy]propylcarbamoyl]phenyl]-6-(dimethylamino)xanthen-3-ylidene]-dimethylazanium (PubChem CID 66898003) has the molecular formula C36H32N5O5S+ and a molecular weight of 646.75 g/mol. Its IUPAC name is [9-[2-carboxy-5-[3-[(2-cyano-1,3-benzothiazol-6-yl)oxy]propylcarbamoyl]phenyl]-6-(dimethylamino)xanthen-3-ylidene]-dimethylazanium.
| Compound Name | [9-[2-carboxy-5-[3-[(2-cyano-1,3-benzothiazol-6-yl)oxy]propylcarbamoyl]phenyl]-6-(dimethylamino)xanthen-3-ylidene]-dimethylazanium |
|---|---|
| PubChem CID | 66898003 |
| Molecular Formula | C36H32N5O5S+ |
| Molecular Weight | 646.75 g/mol |
| Exact Mass | 646.21 |
| IUPAC Name | [9-[2-carboxy-5-[3-[(2-cyano-1,3-benzothiazol-6-yl)oxy]propylcarbamoyl]phenyl]-6-(dimethylamino)xanthen-3-ylidene]-dimethylazanium |
| SMILES | CN(C)c1ccc2c(-c3cc(C(=O)NCCCOc4ccc5nc(C#N)sc5c4)ccc3C(=O)O)c3ccc(=[N+](C)C)cc-3oc2c1 |
| InChI | InChI=1S/C36H31N5O5S/c1-40(2)22-7-11-26-30(17-22)46-31-18-23(41(3)4)8-12-27(31)34(26)28-16-21(6-10-25(28)36(43)44)35(42)38-14-5-15-45-24-9-13-29-32(19-24)47-33(20-37)39-29/h6-13,16-19H,5,14-15H2,1-4H3,(H-,38,42,43,44)/p+1 |
| InChIKey | FHLVYDLECJJWHG-UHFFFAOYSA-O |
| XLogP | 5.68 |
| TPSA | 131.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.75 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|