About bis(1H-imidazol-3-ium);oxalate
bis(1H-imidazol-3-ium);oxalate (PubChem CID 66898159) has the molecular formula C8H10N4O4
and a molecular weight of 226.19 g/mol. Its IUPAC name is bis(1H-imidazol-3-ium);oxalate.
Molecular Properties
| Compound Name | bis(1H-imidazol-3-ium);oxalate |
| PubChem CID | 66898159 |
| Molecular Formula | C8H10N4O4 |
| Molecular Weight | 226.19 g/mol |
| Exact Mass | 226.07 |
| IUPAC Name | bis(1H-imidazol-3-ium);oxalate |
| SMILES | O=C([O-])C(=O)[O-].c1c[nH+]c[nH]1.c1c[nH+]c[nH]1 |
| InChI | InChI=1S/2C3H4N2.C2H2O4/c2*1-2-5-3-4-1;3-1(4)2(5)6/h2*1-3H,(H,4,5);(H,3,4)(H,5,6) |
| InChIKey | HIYDXJFPBJSTFJ-UHFFFAOYSA-N |
| XLogP | -3.86 |
| TPSA | 140.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.19 |
| LogP ≤ 5 | -3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze bis(1H-imidazol-3-ium);oxalate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(1H-imidazol-3-ium);oxalate?
The IUPAC name of bis(1H-imidazol-3-ium);oxalate (CID 66898159) is bis(1H-imidazol-3-ium);oxalate.
What is the SMILES notation for bis(1H-imidazol-3-ium);oxalate?
The canonical SMILES for bis(1H-imidazol-3-ium);oxalate is O=C([O-])C(=O)[O-].c1c[nH+]c[nH]1.c1c[nH+]c[nH]1.
What is the InChIKey of bis(1H-imidazol-3-ium);oxalate?
The InChIKey is HIYDXJFPBJSTFJ-UHFFFAOYSA-N. The full InChI is InChI=1S/2C3H4N2.C2H2O4/c2*1-2-5-3-4-1;3-1(4)2(5)6/h2*1-3H,(H,4,5);(H,3,4)(H,5,6).
What are the key properties of bis(1H-imidazol-3-ium);oxalate?
bis(1H-imidazol-3-ium);oxalate has a molecular weight of 226.19 g/mol, XLogP of -3.86, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis(1H-imidazol-3-ium);oxalate is sourced from PubChem (CID 66898159), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).