C26H31N5O2 — CID 66898425
3-[5-[4-(4-methylpiperazin-1-yl)phenyl]-1H-pyrazol-3-yl]-N-(oxan-4-yl)benzamide (PubChem CID 66898425) has the molecular formula C26H31N5O2 and a molecular weight of 445.57 g/mol. Its IUPAC name is 3-[5-[4-(4-methylpiperazin-1-yl)phenyl]-1H-pyrazol-3-yl]-N-(oxan-4-yl)benzamide.
| Compound Name | 3-[5-[4-(4-methylpiperazin-1-yl)phenyl]-1H-pyrazol-3-yl]-N-(oxan-4-yl)benzamide |
|---|---|
| PubChem CID | 66898425 |
| Molecular Formula | C26H31N5O2 |
| Molecular Weight | 445.57 g/mol |
| Exact Mass | 445.25 |
| IUPAC Name | 3-[5-[4-(4-methylpiperazin-1-yl)phenyl]-1H-pyrazol-3-yl]-N-(oxan-4-yl)benzamide |
| SMILES | CN1CCN(c2ccc(-c3cc(-c4cccc(C(=O)NC5CCOCC5)c4)n[nH]3)cc2)CC1 |
| InChI | InChI=1S/C26H31N5O2/c1-30-11-13-31(14-12-30)23-7-5-19(6-8-23)24-18-25(29-28-24)20-3-2-4-21(17-20)26(32)27-22-9-15-33-16-10-22/h2-8,17-18,22H,9-16H2,1H3,(H,27,32)(H,28,29) |
| InChIKey | SDBFEOZNAMIXBY-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 73.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.57 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |