About 9-prop-2-enylpurine
9-prop-2-enylpurine (PubChem CID 66898867) has the molecular formula C8H8N4
and a molecular weight of 160.18 g/mol. Its IUPAC name is 9-prop-2-enylpurine.
Molecular Properties
| Compound Name | 9-prop-2-enylpurine |
| PubChem CID | 66898867 |
| Molecular Formula | C8H8N4 |
| Molecular Weight | 160.18 g/mol |
| Exact Mass | 160.07 |
| IUPAC Name | 9-prop-2-enylpurine |
| SMILES | C=CCn1cnc2cncnc21 |
| InChI | InChI=1S/C8H8N4/c1-2-3-12-6-11-7-4-9-5-10-8(7)12/h2,4-6H,1,3H2 |
| InChIKey | PTFFSCNJSOGUCW-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.18 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 9-prop-2-enylpurine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-prop-2-enylpurine?
The IUPAC name of 9-prop-2-enylpurine (CID 66898867) is 9-prop-2-enylpurine.
What is the SMILES notation for 9-prop-2-enylpurine?
The canonical SMILES for 9-prop-2-enylpurine is C=CCn1cnc2cncnc21.
What is the InChIKey of 9-prop-2-enylpurine?
The InChIKey is PTFFSCNJSOGUCW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N4/c1-2-3-12-6-11-7-4-9-5-10-8(7)12/h2,4-6H,1,3H2.
What are the key properties of 9-prop-2-enylpurine?
9-prop-2-enylpurine has a molecular weight of 160.18 g/mol, XLogP of 1.01, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 9-prop-2-enylpurine is sourced from PubChem (CID 66898867), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).