About tert-butyl N-benzyl-N-[3-cyano-3-(3,4-dimethoxyphenyl)-2-oxopropyl]carbamate
tert-butyl N-benzyl-N-[3-cyano-3-(3,4-dimethoxyphenyl)-2-oxopropyl]carbamate (PubChem CID 66899172) has the molecular formula C24H28N2O5
and a molecular weight of 424.50 g/mol. Its IUPAC name is tert-butyl N-benzyl-N-[3-cyano-3-(3,4-dimethoxyphenyl)-2-oxopropyl]carbamate.
Molecular Properties
| Compound Name | tert-butyl N-benzyl-N-[3-cyano-3-(3,4-dimethoxyphenyl)-2-oxopropyl]carbamate |
| PubChem CID | 66899172 |
| Molecular Formula | C24H28N2O5 |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 424.20 |
| IUPAC Name | tert-butyl N-benzyl-N-[3-cyano-3-(3,4-dimethoxyphenyl)-2-oxopropyl]carbamate |
| SMILES | COc1ccc(C(C#N)C(=O)CN(Cc2ccccc2)C(=O)OC(C)(C)C)cc1OC |
| InChI | InChI=1S/C24H28N2O5/c1-24(2,3)31-23(28)26(15-17-9-7-6-8-10-17)16-20(27)19(14-25)18-11-12-21(29-4)22(13-18)30-5/h6-13,19H,15-16H2,1-5H3 |
| InChIKey | MMIDAQGMENWDSZ-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 88.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 424.50 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze tert-butyl N-benzyl-N-[3-cyano-3-(3,4-dimethoxyphenyl)-2-oxopropyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-benzyl-N-[3-cyano-3-(3,4-dimethoxyphenyl)-2-oxopropyl]carbamate?
The IUPAC name of tert-butyl N-benzyl-N-[3-cyano-3-(3,4-dimethoxyphenyl)-2-oxopropyl]carbamate (CID 66899172) is tert-butyl N-benzyl-N-[3-cyano-3-(3,4-dimethoxyphenyl)-2-oxopropyl]carbamate.
What is the SMILES notation for tert-butyl N-benzyl-N-[3-cyano-3-(3,4-dimethoxyphenyl)-2-oxopropyl]carbamate?
The canonical SMILES for tert-butyl N-benzyl-N-[3-cyano-3-(3,4-dimethoxyphenyl)-2-oxopropyl]carbamate is COc1ccc(C(C#N)C(=O)CN(Cc2ccccc2)C(=O)OC(C)(C)C)cc1OC.
What is the InChIKey of tert-butyl N-benzyl-N-[3-cyano-3-(3,4-dimethoxyphenyl)-2-oxopropyl]carbamate?
The InChIKey is MMIDAQGMENWDSZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H28N2O5/c1-24(2,3)31-23(28)26(15-17-9-7-6-8-10-17)16-20(27)19(14-25)18-11-12-21(29-4)22(13-18)30-5/h6-13,19H,15-16H2,1-5H3.
What are the key properties of tert-butyl N-benzyl-N-[3-cyano-3-(3,4-dimethoxyphenyl)-2-oxopropyl]carbamate?
tert-butyl N-benzyl-N-[3-cyano-3-(3,4-dimethoxyphenyl)-2-oxopropyl]carbamate has a molecular weight of 424.50 g/mol, XLogP of 4.32, 8 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-benzyl-N-[3-cyano-3-(3,4-dimethoxyphenyl)-2-oxopropyl]carbamate is sourced from PubChem (CID 66899172), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).