C23H24ClFN2O2 — CID 66899701
2-(5-chloro-15-methyl-9,15-diazatetracyclo[10.2.1.02,10.03,8]pentadeca-2(10),3(8),4,6-tetraen-9-yl)-1-(3-fluoro-4-methoxyphenyl)ethanol (PubChem CID 66899701) has the molecular formula C23H24ClFN2O2 and a molecular weight of 414.91 g/mol. Its IUPAC name is 2-(5-chloro-15-methyl-9,15-diazatetracyclo[10.2.1.02,10.03,8]pentadeca-2(10),3(8),4,6-tetraen-9-yl)-1-(3-fluoro-4-methoxyphenyl)ethanol.
| Compound Name | 2-(5-chloro-15-methyl-9,15-diazatetracyclo[10.2.1.02,10.03,8]pentadeca-2(10),3(8),4,6-tetraen-9-yl)-1-(3-fluoro-4-methoxyphenyl)ethanol |
|---|---|
| PubChem CID | 66899701 |
| Molecular Formula | C23H24ClFN2O2 |
| Molecular Weight | 414.91 g/mol |
| Exact Mass | 414.15 |
| IUPAC Name | 2-(5-chloro-15-methyl-9,15-diazatetracyclo[10.2.1.02,10.03,8]pentadeca-2(10),3(8),4,6-tetraen-9-yl)-1-(3-fluoro-4-methoxyphenyl)ethanol |
| SMILES | COc1ccc(C(O)Cn2c3c(c4cc(Cl)ccc42)C2CCC(C3)N2C)cc1F |
| InChI | InChI=1S/C23H24ClFN2O2/c1-26-15-5-7-19(26)23-16-10-14(24)4-6-18(16)27(20(23)11-15)12-21(28)13-3-8-22(29-2)17(25)9-13/h3-4,6,8-10,15,19,21,28H,5,7,11-12H2,1-2H3 |
| InChIKey | ISHDUJCGUOZGBS-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 37.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.91 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|