About 4-[[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]phenol
4-[[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]phenol (PubChem CID 66899808) has the molecular formula C12H16O3
and a molecular weight of 208.26 g/mol. Its IUPAC name is 4-[[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]phenol.
Molecular Properties
| Compound Name | 4-[[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]phenol |
| PubChem CID | 66899808 |
| Molecular Formula | C12H16O3 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.11 |
| IUPAC Name | 4-[[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]phenol |
| SMILES | CC1(C)OC[C@H](Cc2ccc(O)cc2)O1 |
| InChI | InChI=1S/C12H16O3/c1-12(2)14-8-11(15-12)7-9-3-5-10(13)6-4-9/h3-6,11,13H,7-8H2,1-2H3/t11-/m0/s1 |
| InChIKey | SNGOUONKCYYOMS-NSHDSACASA-N |
| XLogP | 2.09 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]phenol?
The IUPAC name of 4-[[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]phenol (CID 66899808) is 4-[[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]phenol.
What is the SMILES notation for 4-[[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]phenol?
The canonical SMILES for 4-[[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]phenol is CC1(C)OC[C@H](Cc2ccc(O)cc2)O1.
What is the InChIKey of 4-[[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]phenol?
The InChIKey is SNGOUONKCYYOMS-NSHDSACASA-N. The full InChI is InChI=1S/C12H16O3/c1-12(2)14-8-11(15-12)7-9-3-5-10(13)6-4-9/h3-6,11,13H,7-8H2,1-2H3/t11-/m0/s1.
What are the key properties of 4-[[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]phenol?
4-[[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]phenol has a molecular weight of 208.26 g/mol, XLogP of 2.09, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]phenol is sourced from PubChem (CID 66899808), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).