About 3-piperazin-1-ylprop-1-ene-1,1-diamine
3-piperazin-1-ylprop-1-ene-1,1-diamine (PubChem CID 66900156) has the molecular formula C7H16N4
and a molecular weight of 156.23 g/mol. Its IUPAC name is 3-piperazin-1-ylprop-1-ene-1,1-diamine.
Molecular Properties
| Compound Name | 3-piperazin-1-ylprop-1-ene-1,1-diamine |
| PubChem CID | 66900156 |
| Molecular Formula | C7H16N4 |
| Molecular Weight | 156.23 g/mol |
| Exact Mass | 156.14 |
| IUPAC Name | 3-piperazin-1-ylprop-1-ene-1,1-diamine |
| SMILES | NC(N)=CCN1CCNCC1 |
| InChI | InChI=1S/C7H16N4/c8-7(9)1-4-11-5-2-10-3-6-11/h1,10H,2-6,8-9H2 |
| InChIKey | KPEKOFWPMNGHFG-UHFFFAOYSA-N |
| XLogP | -1.35 |
| TPSA | 67.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.23 |
| LogP ≤ 5 | -1.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-piperazin-1-ylprop-1-ene-1,1-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-piperazin-1-ylprop-1-ene-1,1-diamine?
The IUPAC name of 3-piperazin-1-ylprop-1-ene-1,1-diamine (CID 66900156) is 3-piperazin-1-ylprop-1-ene-1,1-diamine.
What is the SMILES notation for 3-piperazin-1-ylprop-1-ene-1,1-diamine?
The canonical SMILES for 3-piperazin-1-ylprop-1-ene-1,1-diamine is NC(N)=CCN1CCNCC1.
What is the InChIKey of 3-piperazin-1-ylprop-1-ene-1,1-diamine?
The InChIKey is KPEKOFWPMNGHFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H16N4/c8-7(9)1-4-11-5-2-10-3-6-11/h1,10H,2-6,8-9H2.
What are the key properties of 3-piperazin-1-ylprop-1-ene-1,1-diamine?
3-piperazin-1-ylprop-1-ene-1,1-diamine has a molecular weight of 156.23 g/mol, XLogP of -1.35, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-piperazin-1-ylprop-1-ene-1,1-diamine is sourced from PubChem (CID 66900156), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).