C36H53N5O5SSi2 — CID 66900287
5-(1,1-dioxothian-4-yl)-6-(1-ethoxyethenyl)-3-quinolin-3-yl-N,N-bis(2-trimethylsilylethoxymethyl)pyrazolo[1,5-a]pyrimidin-7-amine (PubChem CID 66900287) has the molecular formula C36H53N5O5SSi2 and a molecular weight of 724.09 g/mol. Its IUPAC name is 5-(1,1-dioxothian-4-yl)-6-(1-ethoxyethenyl)-3-quinolin-3-yl-N,N-bis(2-trimethylsilylethoxymethyl)pyrazolo[1,5-a]pyrimidin-7-amine.
| Compound Name | 5-(1,1-dioxothian-4-yl)-6-(1-ethoxyethenyl)-3-quinolin-3-yl-N,N-bis(2-trimethylsilylethoxymethyl)pyrazolo[1,5-a]pyrimidin-7-amine |
|---|---|
| PubChem CID | 66900287 |
| Molecular Formula | C36H53N5O5SSi2 |
| Molecular Weight | 724.09 g/mol |
| Exact Mass | 723.33 |
| IUPAC Name | 5-(1,1-dioxothian-4-yl)-6-(1-ethoxyethenyl)-3-quinolin-3-yl-N,N-bis(2-trimethylsilylethoxymethyl)pyrazolo[1,5-a]pyrimidin-7-amine |
| SMILES | C=C(OCC)c1c(C2CCS(=O)(=O)CC2)nc2c(-c3cnc4ccccc4c3)cnn2c1N(COCC[Si](C)(C)C)COCC[Si](C)(C)C |
| InChI | InChI=1S/C36H53N5O5SSi2/c1-9-46-27(2)33-34(28-14-18-47(42,43)19-15-28)39-35-31(30-22-29-12-10-11-13-32(29)37-23-30)24-38-41(35)36(33)40(25-44-16-20-48(3,4)5)26-45-17-21-49(6,7)8/h10-13,22-24,28H,2,9,14-21,25-26H2,1,3-8H3 |
| InChIKey | MQVYCIAFCSZQHG-UHFFFAOYSA-N |
| XLogP | 7.67 |
| TPSA | 108.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 724.09 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|