C46H72N6O5Si2 — CID 66900357
tert-butyl 4-[7-[bis(2-trimethylsilylethoxymethyl)amino]-6-(2-ethoxypentyl)-3-(6-phenyl-3-pyridinyl)pyrazolo[1,5-a]pyrimidin-5-yl]piperidine-1-carboxylate (PubChem CID 66900357) has the molecular formula C46H72N6O5Si2 and a molecular weight of 845.29 g/mol. Its IUPAC name is tert-butyl 4-[7-[bis(2-trimethylsilylethoxymethyl)amino]-6-(2-ethoxypentyl)-3-(6-phenyl-3-pyridinyl)pyrazolo[1,5-a]pyrimidin-5-yl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[7-[bis(2-trimethylsilylethoxymethyl)amino]-6-(2-ethoxypentyl)-3-(6-phenyl-3-pyridinyl)pyrazolo[1,5-a]pyrimidin-5-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 66900357 |
| Molecular Formula | C46H72N6O5Si2 |
| Molecular Weight | 845.29 g/mol |
| Exact Mass | 844.51 |
| IUPAC Name | tert-butyl 4-[7-[bis(2-trimethylsilylethoxymethyl)amino]-6-(2-ethoxypentyl)-3-(6-phenyl-3-pyridinyl)pyrazolo[1,5-a]pyrimidin-5-yl]piperidine-1-carboxylate |
| SMILES | CCCC(Cc1c(C2CCN(C(=O)OC(C)(C)C)CC2)nc2c(-c3ccc(-c4ccccc4)nc3)cnn2c1N(COCC[Si](C)(C)C)COCC[Si](C)(C)C)OCC |
| InChI | InChI=1S/C46H72N6O5Si2/c1-12-17-38(56-13-2)30-39-42(36-22-24-50(25-23-36)45(53)57-46(3,4)5)49-43-40(37-20-21-41(47-31-37)35-18-15-14-16-19-35)32-48-52(43)44(39)51(33-54-26-28-58(6,7)8)34-55-27-29-59(9,10)11/h14-16,18-21,31-32,36,38H,12-13,17,22-30,33-34H2,1-11H3 |
| InChIKey | NAQDYFQIUKXQQV-UHFFFAOYSA-N |
| XLogP | 10.75 |
| TPSA | 103.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 845.29 |
| LogP ≤ 5 | 10.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|