About tert-butyl N-cyclopropyl-N-[[2,3-dichloro-5-(3-cyanoprop-2-enyl)phenyl]methyl]carbamate
tert-butyl N-cyclopropyl-N-[[2,3-dichloro-5-(3-cyanoprop-2-enyl)phenyl]methyl]carbamate (PubChem CID 66900731) has the molecular formula C19H22Cl2N2O2
and a molecular weight of 381.30 g/mol. Its IUPAC name is tert-butyl N-cyclopropyl-N-[[2,3-dichloro-5-(3-cyanoprop-2-enyl)phenyl]methyl]carbamate.
Molecular Properties
| Compound Name | tert-butyl N-cyclopropyl-N-[[2,3-dichloro-5-(3-cyanoprop-2-enyl)phenyl]methyl]carbamate |
| PubChem CID | 66900731 |
| Molecular Formula | C19H22Cl2N2O2 |
| Molecular Weight | 381.30 g/mol |
| Exact Mass | 380.11 |
| IUPAC Name | tert-butyl N-cyclopropyl-N-[[2,3-dichloro-5-(3-cyanoprop-2-enyl)phenyl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N(Cc1cc(CC=CC#N)cc(Cl)c1Cl)C1CC1 |
| InChI | InChI=1S/C19H22Cl2N2O2/c1-19(2,3)25-18(24)23(15-7-8-15)12-14-10-13(6-4-5-9-22)11-16(20)17(14)21/h4-5,10-11,15H,6-8,12H2,1-3H3 |
| InChIKey | MIBKLJSSQMSYHG-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 53.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 381.30 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl N-cyclopropyl-N-[[2,3-dichloro-5-(3-cyanoprop-2-enyl)phenyl]methyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-cyclopropyl-N-[[2,3-dichloro-5-(3-cyanoprop-2-enyl)phenyl]methyl]carbamate?
The IUPAC name of tert-butyl N-cyclopropyl-N-[[2,3-dichloro-5-(3-cyanoprop-2-enyl)phenyl]methyl]carbamate (CID 66900731) is tert-butyl N-cyclopropyl-N-[[2,3-dichloro-5-(3-cyanoprop-2-enyl)phenyl]methyl]carbamate.
What is the SMILES notation for tert-butyl N-cyclopropyl-N-[[2,3-dichloro-5-(3-cyanoprop-2-enyl)phenyl]methyl]carbamate?
The canonical SMILES for tert-butyl N-cyclopropyl-N-[[2,3-dichloro-5-(3-cyanoprop-2-enyl)phenyl]methyl]carbamate is CC(C)(C)OC(=O)N(Cc1cc(CC=CC#N)cc(Cl)c1Cl)C1CC1.
What is the InChIKey of tert-butyl N-cyclopropyl-N-[[2,3-dichloro-5-(3-cyanoprop-2-enyl)phenyl]methyl]carbamate?
The InChIKey is MIBKLJSSQMSYHG-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H22Cl2N2O2/c1-19(2,3)25-18(24)23(15-7-8-15)12-14-10-13(6-4-5-9-22)11-16(20)17(14)21/h4-5,10-11,15H,6-8,12H2,1-3H3.
What are the key properties of tert-butyl N-cyclopropyl-N-[[2,3-dichloro-5-(3-cyanoprop-2-enyl)phenyl]methyl]carbamate?
tert-butyl N-cyclopropyl-N-[[2,3-dichloro-5-(3-cyanoprop-2-enyl)phenyl]methyl]carbamate has a molecular weight of 381.30 g/mol, XLogP of 5.52, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-cyclopropyl-N-[[2,3-dichloro-5-(3-cyanoprop-2-enyl)phenyl]methyl]carbamate is sourced from PubChem (CID 66900731), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).