C13H9F3IN3 — CID 66901596
8-iodo-2-(trifluoromethyl)-6,11-dihydro-5H-pyrido[3,2-c][1,5]benzodiazepine (PubChem CID 66901596) has the molecular formula C13H9F3IN3 and a molecular weight of 391.13 g/mol. Its IUPAC name is 8-iodo-2-(trifluoromethyl)-6,11-dihydro-5H-pyrido[3,2-c][1,5]benzodiazepine.
| Compound Name | 8-iodo-2-(trifluoromethyl)-6,11-dihydro-5H-pyrido[3,2-c][1,5]benzodiazepine |
|---|---|
| PubChem CID | 66901596 |
| Molecular Formula | C13H9F3IN3 |
| Molecular Weight | 391.13 g/mol |
| Exact Mass | 390.98 |
| IUPAC Name | 8-iodo-2-(trifluoromethyl)-6,11-dihydro-5H-pyrido[3,2-c][1,5]benzodiazepine |
| SMILES | FC(F)(F)c1ccc2c(n1)Nc1ccc(I)cc1NC2 |
| InChI | InChI=1S/C13H9F3IN3/c14-13(15,16)11-4-1-7-6-18-10-5-8(17)2-3-9(10)19-12(7)20-11/h1-5,18H,6H2,(H,19,20) |
| InChIKey | LAHDDXNXTFNTNO-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.13 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|