C19H37NSi — CID 66902467
N-[dimethyl-(2,3,4,5-tetraethylcyclopenta-2,4-dien-1-yl)silyl]-2-methylpropan-2-amine (PubChem CID 66902467) has the molecular formula C19H37NSi and a molecular weight of 307.60 g/mol. Its IUPAC name is N-[dimethyl-(2,3,4,5-tetraethylcyclopenta-2,4-dien-1-yl)silyl]-2-methylpropan-2-amine.
| Compound Name | N-[dimethyl-(2,3,4,5-tetraethylcyclopenta-2,4-dien-1-yl)silyl]-2-methylpropan-2-amine |
|---|---|
| PubChem CID | 66902467 |
| Molecular Formula | C19H37NSi |
| Molecular Weight | 307.60 g/mol |
| Exact Mass | 307.27 |
| IUPAC Name | N-[dimethyl-(2,3,4,5-tetraethylcyclopenta-2,4-dien-1-yl)silyl]-2-methylpropan-2-amine |
| SMILES | CCC1=C(CC)C([Si](C)(C)NC(C)(C)C)C(CC)=C1CC |
| InChI | InChI=1S/C19H37NSi/c1-10-14-15(11-2)17(13-4)18(16(14)12-3)21(8,9)20-19(5,6)7/h18,20H,10-13H2,1-9H3 |
| InChIKey | BUYVXFCGOANNQX-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.60 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|