C17H26N2O7 — CID 66902735
diethyl (1S,2S,4S,5R,6R)-2-[acetamido(propanoyl)amino]-4-hydroxybicyclo[3.1.0]hexane-2,6-dicarboxylate (PubChem CID 66902735) has the molecular formula C17H26N2O7 and a molecular weight of 370.40 g/mol. Its IUPAC name is diethyl (1S,2S,4S,5R,6R)-2-[acetamido(propanoyl)amino]-4-hydroxybicyclo[3.1.0]hexane-2,6-dicarboxylate.
| Compound Name | diethyl (1S,2S,4S,5R,6R)-2-[acetamido(propanoyl)amino]-4-hydroxybicyclo[3.1.0]hexane-2,6-dicarboxylate |
|---|---|
| PubChem CID | 66902735 |
| Molecular Formula | C17H26N2O7 |
| Molecular Weight | 370.40 g/mol |
| Exact Mass | 370.17 |
| IUPAC Name | diethyl (1S,2S,4S,5R,6R)-2-[acetamido(propanoyl)amino]-4-hydroxybicyclo[3.1.0]hexane-2,6-dicarboxylate |
| SMILES | CCOC(=O)[C@H]1[C@H]2[C@@H]1[C@@](C(=O)OCC)(N(NC(C)=O)C(=O)CC)C[C@@H]2O |
| InChI | InChI=1S/C17H26N2O7/c1-5-11(22)19(18-9(4)20)17(16(24)26-7-3)8-10(21)12-13(14(12)17)15(23)25-6-2/h10,12-14,21H,5-8H2,1-4H3,(H,18,20)/t10-,12-,13-,14-,17-/m0/s1 |
| InChIKey | JCSCJFWLVOTUFF-OTUNNCPPSA-N |
| XLogP | -0.23 |
| TPSA | 122.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.40 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|