C28H37N7O2S — CID 66902743
1-[1-[[2-(1H-indazol-4-yl)-4-morpholin-4-ylthieno[3,2-d]pyrimidin-6-yl]methyl]piperidin-4-yl]-4-methoxybutan-1-amine (PubChem CID 66902743) has the molecular formula C28H37N7O2S and a molecular weight of 535.72 g/mol. Its IUPAC name is 1-[1-[[2-(1H-indazol-4-yl)-4-morpholin-4-ylthieno[3,2-d]pyrimidin-6-yl]methyl]piperidin-4-yl]-4-methoxybutan-1-amine.
| Compound Name | 1-[1-[[2-(1H-indazol-4-yl)-4-morpholin-4-ylthieno[3,2-d]pyrimidin-6-yl]methyl]piperidin-4-yl]-4-methoxybutan-1-amine |
|---|---|
| PubChem CID | 66902743 |
| Molecular Formula | C28H37N7O2S |
| Molecular Weight | 535.72 g/mol |
| Exact Mass | 535.27 |
| IUPAC Name | 1-[1-[[2-(1H-indazol-4-yl)-4-morpholin-4-ylthieno[3,2-d]pyrimidin-6-yl]methyl]piperidin-4-yl]-4-methoxybutan-1-amine |
| SMILES | COCCCC(N)C1CCN(Cc2cc3nc(-c4cccc5[nH]ncc45)nc(N4CCOCC4)c3s2)CC1 |
| InChI | InChI=1S/C28H37N7O2S/c1-36-13-3-5-23(29)19-7-9-34(10-8-19)18-20-16-25-26(38-20)28(35-11-14-37-15-12-35)32-27(31-25)21-4-2-6-24-22(21)17-30-33-24/h2,4,6,16-17,19,23H,3,5,7-15,18,29H2,1H3,(H,30,33) |
| InChIKey | MMIRRZWLINSBMN-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 105.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.72 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|