About 4-(azepan-1-yl)-N-[1-(1,3-thiazol-2-ylmethyl)piperidin-4-yl]pyrimidin-2-amine
4-(azepan-1-yl)-N-[1-(1,3-thiazol-2-ylmethyl)piperidin-4-yl]pyrimidin-2-amine (PubChem CID 66902865) has the molecular formula C19H28N6S
and a molecular weight of 372.54 g/mol. Its IUPAC name is 4-(azepan-1-yl)-N-[1-(1,3-thiazol-2-ylmethyl)piperidin-4-yl]pyrimidin-2-amine.
Molecular Properties
| Compound Name | 4-(azepan-1-yl)-N-[1-(1,3-thiazol-2-ylmethyl)piperidin-4-yl]pyrimidin-2-amine |
| PubChem CID | 66902865 |
| Molecular Formula | C19H28N6S |
| Molecular Weight | 372.54 g/mol |
| Exact Mass | 372.21 |
| IUPAC Name | 4-(azepan-1-yl)-N-[1-(1,3-thiazol-2-ylmethyl)piperidin-4-yl]pyrimidin-2-amine |
| SMILES | c1cc(N2CCCCCC2)nc(NC2CCN(Cc3nccs3)CC2)n1 |
| InChI | InChI=1S/C19H28N6S/c1-2-4-11-25(10-3-1)17-5-8-21-19(23-17)22-16-6-12-24(13-7-16)15-18-20-9-14-26-18/h5,8-9,14,16H,1-4,6-7,10-13,15H2,(H,21,22,23) |
| InChIKey | WAYKUNOYZCYEJC-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 57.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 372.54 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 4-(azepan-1-yl)-N-[1-(1,3-thiazol-2-ylmethyl)piperidin-4-yl]pyrimidin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(azepan-1-yl)-N-[1-(1,3-thiazol-2-ylmethyl)piperidin-4-yl]pyrimidin-2-amine?
The IUPAC name of 4-(azepan-1-yl)-N-[1-(1,3-thiazol-2-ylmethyl)piperidin-4-yl]pyrimidin-2-amine (CID 66902865) is 4-(azepan-1-yl)-N-[1-(1,3-thiazol-2-ylmethyl)piperidin-4-yl]pyrimidin-2-amine.
What is the SMILES notation for 4-(azepan-1-yl)-N-[1-(1,3-thiazol-2-ylmethyl)piperidin-4-yl]pyrimidin-2-amine?
The canonical SMILES for 4-(azepan-1-yl)-N-[1-(1,3-thiazol-2-ylmethyl)piperidin-4-yl]pyrimidin-2-amine is c1cc(N2CCCCCC2)nc(NC2CCN(Cc3nccs3)CC2)n1.
What is the InChIKey of 4-(azepan-1-yl)-N-[1-(1,3-thiazol-2-ylmethyl)piperidin-4-yl]pyrimidin-2-amine?
The InChIKey is WAYKUNOYZCYEJC-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H28N6S/c1-2-4-11-25(10-3-1)17-5-8-21-19(23-17)22-16-6-12-24(13-7-16)15-18-20-9-14-26-18/h5,8-9,14,16H,1-4,6-7,10-13,15H2,(H,21,22,23).
What are the key properties of 4-(azepan-1-yl)-N-[1-(1,3-thiazol-2-ylmethyl)piperidin-4-yl]pyrimidin-2-amine?
4-(azepan-1-yl)-N-[1-(1,3-thiazol-2-ylmethyl)piperidin-4-yl]pyrimidin-2-amine has a molecular weight of 372.54 g/mol, XLogP of 3.39, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(azepan-1-yl)-N-[1-(1,3-thiazol-2-ylmethyl)piperidin-4-yl]pyrimidin-2-amine is sourced from PubChem (CID 66902865), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).