C20H35N5O4 — CID 66902908
(2R,3S,4S)-5-[4-[[4-(azepan-1-yl)pyrimidin-2-yl]amino]piperidin-1-yl]pentane-1,2,3,4-tetrol (PubChem CID 66902908) has the molecular formula C20H35N5O4 and a molecular weight of 409.53 g/mol. Its IUPAC name is (2R,3S,4S)-5-[4-[[4-(azepan-1-yl)pyrimidin-2-yl]amino]piperidin-1-yl]pentane-1,2,3,4-tetrol.
| Compound Name | (2R,3S,4S)-5-[4-[[4-(azepan-1-yl)pyrimidin-2-yl]amino]piperidin-1-yl]pentane-1,2,3,4-tetrol |
|---|---|
| PubChem CID | 66902908 |
| Molecular Formula | C20H35N5O4 |
| Molecular Weight | 409.53 g/mol |
| Exact Mass | 409.27 |
| IUPAC Name | (2R,3S,4S)-5-[4-[[4-(azepan-1-yl)pyrimidin-2-yl]amino]piperidin-1-yl]pentane-1,2,3,4-tetrol |
| SMILES | OC[C@@H](O)[C@@H](O)[C@@H](O)CN1CCC(Nc2nccc(N3CCCCCC3)n2)CC1 |
| InChI | InChI=1S/C20H35N5O4/c26-14-17(28)19(29)16(27)13-24-11-6-15(7-12-24)22-20-21-8-5-18(23-20)25-9-3-1-2-4-10-25/h5,8,15-17,19,26-29H,1-4,6-7,9-14H2,(H,21,22,23)/t16-,17+,19-/m0/s1 |
| InChIKey | IRPPONQMCZRRTN-SCTDSRPQSA-N |
| XLogP | -0.19 |
| TPSA | 125.21 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.53 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |