About 5,6-dichloro-2,2-diethoxyoxasilinane
5,6-dichloro-2,2-diethoxyoxasilinane (PubChem CID 66904915) has the molecular formula C8H16Cl2O3Si
and a molecular weight of 259.20 g/mol. Its IUPAC name is 5,6-dichloro-2,2-diethoxyoxasilinane.
Molecular Properties
| Compound Name | 5,6-dichloro-2,2-diethoxyoxasilinane |
| PubChem CID | 66904915 |
| Molecular Formula | C8H16Cl2O3Si |
| Molecular Weight | 259.20 g/mol |
| Exact Mass | 258.02 |
| IUPAC Name | 5,6-dichloro-2,2-diethoxyoxasilinane |
| SMILES | CCO[Si]1(OCC)CCC(Cl)C(Cl)O1 |
| InChI | InChI=1S/C8H16Cl2O3Si/c1-3-11-14(12-4-2)6-5-7(9)8(10)13-14/h7-8H,3-6H2,1-2H3 |
| InChIKey | WCGNFRCBCZXAMM-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.20 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 5,6-dichloro-2,2-diethoxyoxasilinane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6-dichloro-2,2-diethoxyoxasilinane?
The IUPAC name of 5,6-dichloro-2,2-diethoxyoxasilinane (CID 66904915) is 5,6-dichloro-2,2-diethoxyoxasilinane.
What is the SMILES notation for 5,6-dichloro-2,2-diethoxyoxasilinane?
The canonical SMILES for 5,6-dichloro-2,2-diethoxyoxasilinane is CCO[Si]1(OCC)CCC(Cl)C(Cl)O1.
What is the InChIKey of 5,6-dichloro-2,2-diethoxyoxasilinane?
The InChIKey is WCGNFRCBCZXAMM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16Cl2O3Si/c1-3-11-14(12-4-2)6-5-7(9)8(10)13-14/h7-8H,3-6H2,1-2H3.
What are the key properties of 5,6-dichloro-2,2-diethoxyoxasilinane?
5,6-dichloro-2,2-diethoxyoxasilinane has a molecular weight of 259.20 g/mol, XLogP of 2.59, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-dichloro-2,2-diethoxyoxasilinane is sourced from PubChem (CID 66904915), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).