About 3-bromo-4,5-dihydro-1H-pyridazin-6-one
3-bromo-4,5-dihydro-1H-pyridazin-6-one (PubChem CID 66905029) has the molecular formula C4H5BrN2O
and a molecular weight of 177.00 g/mol. Its IUPAC name is 3-bromo-4,5-dihydro-1H-pyridazin-6-one.
Molecular Properties
| Compound Name | 3-bromo-4,5-dihydro-1H-pyridazin-6-one |
| PubChem CID | 66905029 |
| Molecular Formula | C4H5BrN2O |
| Molecular Weight | 177.00 g/mol |
| Exact Mass | 175.96 |
| IUPAC Name | 3-bromo-4,5-dihydro-1H-pyridazin-6-one |
| SMILES | O=C1CCC(Br)=NN1 |
| InChI | InChI=1S/C4H5BrN2O/c5-3-1-2-4(8)7-6-3/h1-2H2,(H,7,8) |
| InChIKey | MRLOIRWZHRICRK-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.00 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-bromo-4,5-dihydro-1H-pyridazin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-4,5-dihydro-1H-pyridazin-6-one?
The IUPAC name of 3-bromo-4,5-dihydro-1H-pyridazin-6-one (CID 66905029) is 3-bromo-4,5-dihydro-1H-pyridazin-6-one.
What is the SMILES notation for 3-bromo-4,5-dihydro-1H-pyridazin-6-one?
The canonical SMILES for 3-bromo-4,5-dihydro-1H-pyridazin-6-one is O=C1CCC(Br)=NN1.
What is the InChIKey of 3-bromo-4,5-dihydro-1H-pyridazin-6-one?
The InChIKey is MRLOIRWZHRICRK-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H5BrN2O/c5-3-1-2-4(8)7-6-3/h1-2H2,(H,7,8).
What are the key properties of 3-bromo-4,5-dihydro-1H-pyridazin-6-one?
3-bromo-4,5-dihydro-1H-pyridazin-6-one has a molecular weight of 177.00 g/mol, XLogP of 0.60, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-4,5-dihydro-1H-pyridazin-6-one is sourced from PubChem (CID 66905029), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).