C12H13ClN2O3 — CID 66905049
3-(7-oxo-6,8-dihydro-5H-1,8-naphthyridin-3-yl)but-2-enoic acid;hydrochloride (PubChem CID 66905049) has the molecular formula C12H13ClN2O3 and a molecular weight of 268.70 g/mol. Its IUPAC name is 3-(7-oxo-6,8-dihydro-5H-1,8-naphthyridin-3-yl)but-2-enoic acid;hydrochloride.
| Compound Name | 3-(7-oxo-6,8-dihydro-5H-1,8-naphthyridin-3-yl)but-2-enoic acid;hydrochloride |
|---|---|
| PubChem CID | 66905049 |
| Molecular Formula | C12H13ClN2O3 |
| Molecular Weight | 268.70 g/mol |
| Exact Mass | 268.06 |
| IUPAC Name | 3-(7-oxo-6,8-dihydro-5H-1,8-naphthyridin-3-yl)but-2-enoic acid;hydrochloride |
| SMILES | CC(=CC(=O)O)c1cnc2c(c1)CCC(=O)N2.Cl |
| InChI | InChI=1S/C12H12N2O3.ClH/c1-7(4-11(16)17)9-5-8-2-3-10(15)14-12(8)13-6-9;/h4-6H,2-3H2,1H3,(H,16,17)(H,13,14,15);1H |
| InChIKey | QLWQZGWWPWBAOF-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.70 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|