C18H29N3O2 — CID 66905155
(6R,7R)-6-methoxy-8,8-dimethyl-7-[3-(methylamino)propylamino]-6,7-dihydro-5H-naphthalene-2-carboxamide (PubChem CID 66905155) has the molecular formula C18H29N3O2 and a molecular weight of 319.45 g/mol. Its IUPAC name is (6R,7R)-6-methoxy-8,8-dimethyl-7-[3-(methylamino)propylamino]-6,7-dihydro-5H-naphthalene-2-carboxamide.
| Compound Name | (6R,7R)-6-methoxy-8,8-dimethyl-7-[3-(methylamino)propylamino]-6,7-dihydro-5H-naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 66905155 |
| Molecular Formula | C18H29N3O2 |
| Molecular Weight | 319.45 g/mol |
| Exact Mass | 319.23 |
| IUPAC Name | (6R,7R)-6-methoxy-8,8-dimethyl-7-[3-(methylamino)propylamino]-6,7-dihydro-5H-naphthalene-2-carboxamide |
| SMILES | CNCCCNC1[C@H](OC)Cc2ccc(C(N)=O)cc2C1(C)C |
| InChI | InChI=1S/C18H29N3O2/c1-18(2)14-10-13(17(19)22)7-6-12(14)11-15(23-4)16(18)21-9-5-8-20-3/h6-7,10,15-16,20-21H,5,8-9,11H2,1-4H3,(H2,19,22)/t15-,16?/m1/s1 |
| InChIKey | WSKWNLAGILPRND-AAFJCEBUSA-N |
| XLogP | 1.20 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.45 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|