C16H20N2O3 — CID 66905252
2-tert-butyl-3-(7-oxo-6,8-dihydro-5H-1,8-naphthyridin-3-yl)but-2-enoic acid (PubChem CID 66905252) has the molecular formula C16H20N2O3 and a molecular weight of 288.35 g/mol. Its IUPAC name is 2-tert-butyl-3-(7-oxo-6,8-dihydro-5H-1,8-naphthyridin-3-yl)but-2-enoic acid.
| Compound Name | 2-tert-butyl-3-(7-oxo-6,8-dihydro-5H-1,8-naphthyridin-3-yl)but-2-enoic acid |
|---|---|
| PubChem CID | 66905252 |
| Molecular Formula | C16H20N2O3 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | 2-tert-butyl-3-(7-oxo-6,8-dihydro-5H-1,8-naphthyridin-3-yl)but-2-enoic acid |
| SMILES | CC(=C(C(=O)O)C(C)(C)C)c1cnc2c(c1)CCC(=O)N2 |
| InChI | InChI=1S/C16H20N2O3/c1-9(13(15(20)21)16(2,3)4)11-7-10-5-6-12(19)18-14(10)17-8-11/h7-8H,5-6H2,1-4H3,(H,20,21)(H,17,18,19) |
| InChIKey | WAWBLJFMVUKYFK-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|