C21H22N4O2 — CID 66905357
3-(3,4-dihydro-2H-pyrido[3,2-b][1,4]oxazin-7-yl)-N-methyl-N-[(1-methylindol-3-yl)methyl]prop-2-enamide (PubChem CID 66905357) has the molecular formula C21H22N4O2 and a molecular weight of 362.43 g/mol. Its IUPAC name is 3-(3,4-dihydro-2H-pyrido[3,2-b][1,4]oxazin-7-yl)-N-methyl-N-[(1-methylindol-3-yl)methyl]prop-2-enamide.
| Compound Name | 3-(3,4-dihydro-2H-pyrido[3,2-b][1,4]oxazin-7-yl)-N-methyl-N-[(1-methylindol-3-yl)methyl]prop-2-enamide |
|---|---|
| PubChem CID | 66905357 |
| Molecular Formula | C21H22N4O2 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.17 |
| IUPAC Name | 3-(3,4-dihydro-2H-pyrido[3,2-b][1,4]oxazin-7-yl)-N-methyl-N-[(1-methylindol-3-yl)methyl]prop-2-enamide |
| SMILES | CN(Cc1cn(C)c2ccccc12)C(=O)C=Cc1cnc2c(c1)OCCN2 |
| InChI | InChI=1S/C21H22N4O2/c1-24-13-16(17-5-3-4-6-18(17)24)14-25(2)20(26)8-7-15-11-19-21(23-12-15)22-9-10-27-19/h3-8,11-13H,9-10,14H2,1-2H3,(H,22,23) |
| InChIKey | UEHCZUVGWUJNSC-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|