About 3-fluoro-N-(1,2,4-thiadiazol-5-yl)benzenesulfonamide
3-fluoro-N-(1,2,4-thiadiazol-5-yl)benzenesulfonamide (PubChem CID 66905458) has the molecular formula C8H6FN3O2S2
and a molecular weight of 259.29 g/mol. Its IUPAC name is 3-fluoro-N-(1,2,4-thiadiazol-5-yl)benzenesulfonamide.
Molecular Properties
| Compound Name | 3-fluoro-N-(1,2,4-thiadiazol-5-yl)benzenesulfonamide |
| PubChem CID | 66905458 |
| Molecular Formula | C8H6FN3O2S2 |
| Molecular Weight | 259.29 g/mol |
| Exact Mass | 258.99 |
| IUPAC Name | 3-fluoro-N-(1,2,4-thiadiazol-5-yl)benzenesulfonamide |
| SMILES | O=S(=O)(Nc1ncns1)c1cccc(F)c1 |
| InChI | InChI=1S/C8H6FN3O2S2/c9-6-2-1-3-7(4-6)16(13,14)12-8-10-5-11-15-8/h1-5H,(H,10,11,12) |
| InChIKey | JVXYRBASMHQXKG-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.29 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-fluoro-N-(1,2,4-thiadiazol-5-yl)benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-fluoro-N-(1,2,4-thiadiazol-5-yl)benzenesulfonamide?
The IUPAC name of 3-fluoro-N-(1,2,4-thiadiazol-5-yl)benzenesulfonamide (CID 66905458) is 3-fluoro-N-(1,2,4-thiadiazol-5-yl)benzenesulfonamide.
What is the SMILES notation for 3-fluoro-N-(1,2,4-thiadiazol-5-yl)benzenesulfonamide?
The canonical SMILES for 3-fluoro-N-(1,2,4-thiadiazol-5-yl)benzenesulfonamide is O=S(=O)(Nc1ncns1)c1cccc(F)c1.
What is the InChIKey of 3-fluoro-N-(1,2,4-thiadiazol-5-yl)benzenesulfonamide?
The InChIKey is JVXYRBASMHQXKG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6FN3O2S2/c9-6-2-1-3-7(4-6)16(13,14)12-8-10-5-11-15-8/h1-5H,(H,10,11,12).
What are the key properties of 3-fluoro-N-(1,2,4-thiadiazol-5-yl)benzenesulfonamide?
3-fluoro-N-(1,2,4-thiadiazol-5-yl)benzenesulfonamide has a molecular weight of 259.29 g/mol, XLogP of 1.48, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-fluoro-N-(1,2,4-thiadiazol-5-yl)benzenesulfonamide is sourced from PubChem (CID 66905458), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).