C14H18BrNO — CID 66905907
(5S)-7-bromo-5-methyl-8-prop-2-enoxy-2,3,4,5-tetrahydro-1H-3-benzazepine (PubChem CID 66905907) has the molecular formula C14H18BrNO and a molecular weight of 296.21 g/mol. Its IUPAC name is (5S)-7-bromo-5-methyl-8-prop-2-enoxy-2,3,4,5-tetrahydro-1H-3-benzazepine.
| Compound Name | (5S)-7-bromo-5-methyl-8-prop-2-enoxy-2,3,4,5-tetrahydro-1H-3-benzazepine |
|---|---|
| PubChem CID | 66905907 |
| Molecular Formula | C14H18BrNO |
| Molecular Weight | 296.21 g/mol |
| Exact Mass | 295.06 |
| IUPAC Name | (5S)-7-bromo-5-methyl-8-prop-2-enoxy-2,3,4,5-tetrahydro-1H-3-benzazepine |
| SMILES | C=CCOc1cc2c(cc1Br)[C@H](C)CNCC2 |
| InChI | InChI=1S/C14H18BrNO/c1-3-6-17-14-7-11-4-5-16-9-10(2)12(11)8-13(14)15/h3,7-8,10,16H,1,4-6,9H2,2H3/t10-/m1/s1 |
| InChIKey | IYWYWVMPIJVOBD-SNVBAGLBSA-N |
| XLogP | 3.26 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.21 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|