C36H47F3N6O5 — CID 66906483
N-(N'-butylcarbamimidoyl)-3-[3-(3-methoxypropoxy)-4-[4-[(4-pyridin-2-ylpiperazin-1-yl)methyl]phenyl]phenyl]propanamide;2,2,2-trifluoroacetic acid (PubChem CID 66906483) has the molecular formula C36H47F3N6O5 and a molecular weight of 700.80 g/mol. Its IUPAC name is N-(N'-butylcarbamimidoyl)-3-[3-(3-methoxypropoxy)-4-[4-[(4-pyridin-2-ylpiperazin-1-yl)methyl]phenyl]phenyl]propanamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-(N'-butylcarbamimidoyl)-3-[3-(3-methoxypropoxy)-4-[4-[(4-pyridin-2-ylpiperazin-1-yl)methyl]phenyl]phenyl]propanamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 66906483 |
| Molecular Formula | C36H47F3N6O5 |
| Molecular Weight | 700.80 g/mol |
| Exact Mass | 700.36 |
| IUPAC Name | N-(N'-butylcarbamimidoyl)-3-[3-(3-methoxypropoxy)-4-[4-[(4-pyridin-2-ylpiperazin-1-yl)methyl]phenyl]phenyl]propanamide;2,2,2-trifluoroacetic acid |
| SMILES | CCCC/N=C(\N)NC(=O)CCc1ccc(-c2ccc(CN3CCN(c4ccccn4)CC3)cc2)c(OCCCOC)c1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C34H46N6O3.C2HF3O2/c1-3-4-17-37-34(35)38-33(41)16-12-27-11-15-30(31(25-27)43-24-7-23-42-2)29-13-9-28(10-14-29)26-39-19-21-40(22-20-39)32-8-5-6-18-36-32;3-2(4,5)1(6)7/h5-6,8-11,13-15,18,25H,3-4,7,12,16-17,19-24,26H2,1-2H3,(H3,35,37,38,41);(H,6,7) |
| InChIKey | HLACZYSPNBKEES-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 142.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.80 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|