C21H17NO2S2 — CID 66907345
N-(1-benzothiophen-2-yl)-N-benzylbenzenesulfonamide (PubChem CID 66907345) has the molecular formula C21H17NO2S2 and a molecular weight of 379.51 g/mol. Its IUPAC name is N-(1-benzothiophen-2-yl)-N-benzylbenzenesulfonamide.
| Compound Name | N-(1-benzothiophen-2-yl)-N-benzylbenzenesulfonamide |
|---|---|
| PubChem CID | 66907345 |
| Molecular Formula | C21H17NO2S2 |
| Molecular Weight | 379.51 g/mol |
| Exact Mass | 379.07 |
| IUPAC Name | N-(1-benzothiophen-2-yl)-N-benzylbenzenesulfonamide |
| SMILES | O=S(=O)(c1ccccc1)N(Cc1ccccc1)c1cc2ccccc2s1 |
| InChI | InChI=1S/C21H17NO2S2/c23-26(24,19-12-5-2-6-13-19)22(16-17-9-3-1-4-10-17)21-15-18-11-7-8-14-20(18)25-21/h1-15H,16H2 |
| InChIKey | LZBWWDLNOMNOHU-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.51 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |