C22H26N2O2S2 — CID 66907634
N-(3-methyl-1-benzothiophen-2-yl)-N-(2-piperidin-1-ylethyl)benzenesulfonamide (PubChem CID 66907634) has the molecular formula C22H26N2O2S2 and a molecular weight of 414.60 g/mol. Its IUPAC name is N-(3-methyl-1-benzothiophen-2-yl)-N-(2-piperidin-1-ylethyl)benzenesulfonamide.
| Compound Name | N-(3-methyl-1-benzothiophen-2-yl)-N-(2-piperidin-1-ylethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 66907634 |
| Molecular Formula | C22H26N2O2S2 |
| Molecular Weight | 414.60 g/mol |
| Exact Mass | 414.14 |
| IUPAC Name | N-(3-methyl-1-benzothiophen-2-yl)-N-(2-piperidin-1-ylethyl)benzenesulfonamide |
| SMILES | Cc1c(N(CCN2CCCCC2)S(=O)(=O)c2ccccc2)sc2ccccc12 |
| InChI | InChI=1S/C22H26N2O2S2/c1-18-20-12-6-7-13-21(20)27-22(18)24(17-16-23-14-8-3-9-15-23)28(25,26)19-10-4-2-5-11-19/h2,4-7,10-13H,3,8-9,14-17H2,1H3 |
| InChIKey | BHSMBEMOQHIYRB-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.60 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |