C11H11N3O3 — CID 66908004
5-(2,3-dihydrofuro[2,3-b]pyridin-5-yl)-5-methylimidazolidine-2,4-dione (PubChem CID 66908004) has the molecular formula C11H11N3O3 and a molecular weight of 233.23 g/mol. Its IUPAC name is 5-(2,3-dihydrofuro[2,3-b]pyridin-5-yl)-5-methylimidazolidine-2,4-dione.
| Compound Name | 5-(2,3-dihydrofuro[2,3-b]pyridin-5-yl)-5-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 66908004 |
| Molecular Formula | C11H11N3O3 |
| Molecular Weight | 233.23 g/mol |
| Exact Mass | 233.08 |
| IUPAC Name | 5-(2,3-dihydrofuro[2,3-b]pyridin-5-yl)-5-methylimidazolidine-2,4-dione |
| SMILES | CC1(c2cnc3c(c2)CCO3)NC(=O)NC1=O |
| InChI | InChI=1S/C11H11N3O3/c1-11(9(15)13-10(16)14-11)7-4-6-2-3-17-8(6)12-5-7/h4-5H,2-3H2,1H3,(H2,13,14,15,16) |
| InChIKey | HVXYVBMXDLHNRV-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.23 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|