C8H12F3N3O4 — CID 66908013
(5R)-5-(1-aminoethyl)-3-methylimidazolidine-2,4-dione;2,2,2-trifluoroacetic acid (PubChem CID 66908013) has the molecular formula C8H12F3N3O4 and a molecular weight of 271.19 g/mol. Its IUPAC name is (5R)-5-(1-aminoethyl)-3-methylimidazolidine-2,4-dione;2,2,2-trifluoroacetic acid.
| Compound Name | (5R)-5-(1-aminoethyl)-3-methylimidazolidine-2,4-dione;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 66908013 |
| Molecular Formula | C8H12F3N3O4 |
| Molecular Weight | 271.19 g/mol |
| Exact Mass | 271.08 |
| IUPAC Name | (5R)-5-(1-aminoethyl)-3-methylimidazolidine-2,4-dione;2,2,2-trifluoroacetic acid |
| SMILES | CC(N)[C@H]1NC(=O)N(C)C1=O.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C6H11N3O2.C2HF3O2/c1-3(7)4-5(10)9(2)6(11)8-4;3-2(4,5)1(6)7/h3-4H,7H2,1-2H3,(H,8,11);(H,6,7)/t3?,4-;/m1./s1 |
| InChIKey | PAETZSNZAGKUEP-ZAQOELHGSA-N |
| XLogP | -0.48 |
| TPSA | 112.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.19 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|