About 1-[(3-fluorophenyl)methyl]-5-(trifluoromethyl)pyrrolo[3,2-b]pyridine;propanoic acid
1-[(3-fluorophenyl)methyl]-5-(trifluoromethyl)pyrrolo[3,2-b]pyridine;propanoic acid (PubChem CID 66908094) has the molecular formula C18H16F4N2O2
and a molecular weight of 368.33 g/mol. Its IUPAC name is 1-[(3-fluorophenyl)methyl]-5-(trifluoromethyl)pyrrolo[3,2-b]pyridine;propanoic acid.
Molecular Properties
| Compound Name | 1-[(3-fluorophenyl)methyl]-5-(trifluoromethyl)pyrrolo[3,2-b]pyridine;propanoic acid |
| PubChem CID | 66908094 |
| Molecular Formula | C18H16F4N2O2 |
| Molecular Weight | 368.33 g/mol |
| Exact Mass | 368.11 |
| IUPAC Name | 1-[(3-fluorophenyl)methyl]-5-(trifluoromethyl)pyrrolo[3,2-b]pyridine;propanoic acid |
| SMILES | CCC(=O)O.Fc1cccc(Cn2ccc3nc(C(F)(F)F)ccc32)c1 |
| InChI | InChI=1S/C15H10F4N2.C3H6O2/c16-11-3-1-2-10(8-11)9-21-7-6-12-13(21)4-5-14(20-12)15(17,18)19;1-2-3(4)5/h1-8H,9H2;2H2,1H3,(H,4,5) |
| InChIKey | DEJGTZWBUHUPKW-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.33 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[(3-fluorophenyl)methyl]-5-(trifluoromethyl)pyrrolo[3,2-b]pyridine;propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(3-fluorophenyl)methyl]-5-(trifluoromethyl)pyrrolo[3,2-b]pyridine;propanoic acid?
The IUPAC name of 1-[(3-fluorophenyl)methyl]-5-(trifluoromethyl)pyrrolo[3,2-b]pyridine;propanoic acid (CID 66908094) is 1-[(3-fluorophenyl)methyl]-5-(trifluoromethyl)pyrrolo[3,2-b]pyridine;propanoic acid.
What is the SMILES notation for 1-[(3-fluorophenyl)methyl]-5-(trifluoromethyl)pyrrolo[3,2-b]pyridine;propanoic acid?
The canonical SMILES for 1-[(3-fluorophenyl)methyl]-5-(trifluoromethyl)pyrrolo[3,2-b]pyridine;propanoic acid is CCC(=O)O.Fc1cccc(Cn2ccc3nc(C(F)(F)F)ccc32)c1.
What is the InChIKey of 1-[(3-fluorophenyl)methyl]-5-(trifluoromethyl)pyrrolo[3,2-b]pyridine;propanoic acid?
The InChIKey is DEJGTZWBUHUPKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H10F4N2.C3H6O2/c16-11-3-1-2-10(8-11)9-21-7-6-12-13(21)4-5-14(20-12)15(17,18)19;1-2-3(4)5/h1-8H,9H2;2H2,1H3,(H,4,5).
What are the key properties of 1-[(3-fluorophenyl)methyl]-5-(trifluoromethyl)pyrrolo[3,2-b]pyridine;propanoic acid?
1-[(3-fluorophenyl)methyl]-5-(trifluoromethyl)pyrrolo[3,2-b]pyridine;propanoic acid has a molecular weight of 368.33 g/mol, XLogP of 4.72, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(3-fluorophenyl)methyl]-5-(trifluoromethyl)pyrrolo[3,2-b]pyridine;propanoic acid is sourced from PubChem (CID 66908094), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).