C10H14N2O4 — CID 66908146
1-(4-methylpentyl)-1,3-diazinane-2,4,5,6-tetrone (PubChem CID 66908146) has the molecular formula C10H14N2O4 and a molecular weight of 226.23 g/mol. Its IUPAC name is 1-(4-methylpentyl)-1,3-diazinane-2,4,5,6-tetrone.
| Compound Name | 1-(4-methylpentyl)-1,3-diazinane-2,4,5,6-tetrone |
|---|---|
| PubChem CID | 66908146 |
| Molecular Formula | C10H14N2O4 |
| Molecular Weight | 226.23 g/mol |
| Exact Mass | 226.10 |
| IUPAC Name | 1-(4-methylpentyl)-1,3-diazinane-2,4,5,6-tetrone |
| SMILES | CC(C)CCCN1C(=O)NC(=O)C(=O)C1=O |
| InChI | InChI=1S/C10H14N2O4/c1-6(2)4-3-5-12-9(15)7(13)8(14)11-10(12)16/h6H,3-5H2,1-2H3,(H,11,14,16) |
| InChIKey | HOVPQPCWTRCIAZ-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.23 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|