C15H25N5 — CID 66908167
4-(azepan-1-yl)-N-(pyrrolidin-2-ylmethyl)pyrimidin-2-amine (PubChem CID 66908167) has the molecular formula C15H25N5 and a molecular weight of 275.40 g/mol. Its IUPAC name is 4-(azepan-1-yl)-N-(pyrrolidin-2-ylmethyl)pyrimidin-2-amine.
| Compound Name | 4-(azepan-1-yl)-N-(pyrrolidin-2-ylmethyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 66908167 |
| Molecular Formula | C15H25N5 |
| Molecular Weight | 275.40 g/mol |
| Exact Mass | 275.21 |
| IUPAC Name | 4-(azepan-1-yl)-N-(pyrrolidin-2-ylmethyl)pyrimidin-2-amine |
| SMILES | c1cc(N2CCCCCC2)nc(NCC2CCCN2)n1 |
| InChI | InChI=1S/C15H25N5/c1-2-4-11-20(10-3-1)14-7-9-17-15(19-14)18-12-13-6-5-8-16-13/h7,9,13,16H,1-6,8,10-12H2,(H,17,18,19) |
| InChIKey | LKJCLFWWIIZTGI-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 53.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.40 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |