About methyl 2-[(1R,5S,6R)-6-methyl-4-oxo-2-thiabicyclo[3.1.0]hexan-6-yl]acetate
methyl 2-[(1R,5S,6R)-6-methyl-4-oxo-2-thiabicyclo[3.1.0]hexan-6-yl]acetate (PubChem CID 66908431) has the molecular formula C9H12O3S
and a molecular weight of 200.26 g/mol. Its IUPAC name is methyl 2-[(1R,5S,6R)-6-methyl-4-oxo-2-thiabicyclo[3.1.0]hexan-6-yl]acetate.
Molecular Properties
| Compound Name | methyl 2-[(1R,5S,6R)-6-methyl-4-oxo-2-thiabicyclo[3.1.0]hexan-6-yl]acetate |
| PubChem CID | 66908431 |
| Molecular Formula | C9H12O3S |
| Molecular Weight | 200.26 g/mol |
| Exact Mass | 200.05 |
| IUPAC Name | methyl 2-[(1R,5S,6R)-6-methyl-4-oxo-2-thiabicyclo[3.1.0]hexan-6-yl]acetate |
| SMILES | COC(=O)C[C@@]1(C)[C@@H]2SCC(=O)[C@@H]21 |
| InChI | InChI=1S/C9H12O3S/c1-9(3-6(11)12-2)7-5(10)4-13-8(7)9/h7-8H,3-4H2,1-2H3/t7-,8+,9+/m0/s1 |
| InChIKey | ACZBWTZHHPXCAL-DJLDLDEBSA-N |
| XLogP | 0.87 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.26 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 2-[(1R,5S,6R)-6-methyl-4-oxo-2-thiabicyclo[3.1.0]hexan-6-yl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[(1R,5S,6R)-6-methyl-4-oxo-2-thiabicyclo[3.1.0]hexan-6-yl]acetate?
The IUPAC name of methyl 2-[(1R,5S,6R)-6-methyl-4-oxo-2-thiabicyclo[3.1.0]hexan-6-yl]acetate (CID 66908431) is methyl 2-[(1R,5S,6R)-6-methyl-4-oxo-2-thiabicyclo[3.1.0]hexan-6-yl]acetate.
What is the SMILES notation for methyl 2-[(1R,5S,6R)-6-methyl-4-oxo-2-thiabicyclo[3.1.0]hexan-6-yl]acetate?
The canonical SMILES for methyl 2-[(1R,5S,6R)-6-methyl-4-oxo-2-thiabicyclo[3.1.0]hexan-6-yl]acetate is COC(=O)C[C@@]1(C)[C@@H]2SCC(=O)[C@@H]21.
What is the InChIKey of methyl 2-[(1R,5S,6R)-6-methyl-4-oxo-2-thiabicyclo[3.1.0]hexan-6-yl]acetate?
The InChIKey is ACZBWTZHHPXCAL-DJLDLDEBSA-N. The full InChI is InChI=1S/C9H12O3S/c1-9(3-6(11)12-2)7-5(10)4-13-8(7)9/h7-8H,3-4H2,1-2H3/t7-,8+,9+/m0/s1.
What are the key properties of methyl 2-[(1R,5S,6R)-6-methyl-4-oxo-2-thiabicyclo[3.1.0]hexan-6-yl]acetate?
methyl 2-[(1R,5S,6R)-6-methyl-4-oxo-2-thiabicyclo[3.1.0]hexan-6-yl]acetate has a molecular weight of 200.26 g/mol, XLogP of 0.87, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[(1R,5S,6R)-6-methyl-4-oxo-2-thiabicyclo[3.1.0]hexan-6-yl]acetate is sourced from PubChem (CID 66908431), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).