C20H26N2O5 — CID 66908522
bis(2-aminoethyl) (2S,3R,4S,5R)-2-ethenyl-5-(2-phenylethenyl)oxolane-3,4-dicarboxylate (PubChem CID 66908522) has the molecular formula C20H26N2O5 and a molecular weight of 374.44 g/mol. Its IUPAC name is bis(2-aminoethyl) (2S,3R,4S,5R)-2-ethenyl-5-(2-phenylethenyl)oxolane-3,4-dicarboxylate.
| Compound Name | bis(2-aminoethyl) (2S,3R,4S,5R)-2-ethenyl-5-(2-phenylethenyl)oxolane-3,4-dicarboxylate |
|---|---|
| PubChem CID | 66908522 |
| Molecular Formula | C20H26N2O5 |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.18 |
| IUPAC Name | bis(2-aminoethyl) (2S,3R,4S,5R)-2-ethenyl-5-(2-phenylethenyl)oxolane-3,4-dicarboxylate |
| SMILES | C=C[C@@H]1O[C@H](C=Cc2ccccc2)[C@@H](C(=O)OCCN)[C@H]1C(=O)OCCN |
| InChI | InChI=1S/C20H26N2O5/c1-2-15-17(19(23)25-12-10-21)18(20(24)26-13-11-22)16(27-15)9-8-14-6-4-3-5-7-14/h2-9,15-18H,1,10-13,21-22H2/t15-,16+,17-,18+/m0/s1 |
| InChIKey | OIJSURABCFIGNT-XWTMOSNGSA-N |
| XLogP | 0.89 |
| TPSA | 113.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|