About 1-methylsulfonyl-3,4-dihydro-2H-quinoline
1-methylsulfonyl-3,4-dihydro-2H-quinoline (PubChem CID 669103) has the molecular formula C10H13NO2S
and a molecular weight of 211.29 g/mol. Its IUPAC name is 1-methylsulfonyl-3,4-dihydro-2H-quinoline.
Molecular Properties
| Compound Name | 1-methylsulfonyl-3,4-dihydro-2H-quinoline |
| PubChem CID | 669103 |
| Molecular Formula | C10H13NO2S |
| Molecular Weight | 211.29 g/mol |
| Exact Mass | 211.07 |
| IUPAC Name | 1-methylsulfonyl-3,4-dihydro-2H-quinoline |
| SMILES | CS(=O)(=O)N1CCCc2ccccc21 |
| InChI | InChI=1S/C10H13NO2S/c1-14(12,13)11-8-4-6-9-5-2-3-7-10(9)11/h2-3,5,7H,4,6,8H2,1H3 |
| InChIKey | ZOPZYWPRKRGGTC-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.29 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-methylsulfonyl-3,4-dihydro-2H-quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methylsulfonyl-3,4-dihydro-2H-quinoline?
The IUPAC name of 1-methylsulfonyl-3,4-dihydro-2H-quinoline (CID 669103) is 1-methylsulfonyl-3,4-dihydro-2H-quinoline.
What is the SMILES notation for 1-methylsulfonyl-3,4-dihydro-2H-quinoline?
The canonical SMILES for 1-methylsulfonyl-3,4-dihydro-2H-quinoline is CS(=O)(=O)N1CCCc2ccccc21.
What is the InChIKey of 1-methylsulfonyl-3,4-dihydro-2H-quinoline?
The InChIKey is ZOPZYWPRKRGGTC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NO2S/c1-14(12,13)11-8-4-6-9-5-2-3-7-10(9)11/h2-3,5,7H,4,6,8H2,1H3.
What are the key properties of 1-methylsulfonyl-3,4-dihydro-2H-quinoline?
1-methylsulfonyl-3,4-dihydro-2H-quinoline has a molecular weight of 211.29 g/mol, XLogP of 1.40, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methylsulfonyl-3,4-dihydro-2H-quinoline is sourced from PubChem (CID 669103), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).