About 6-methyl-1-propan-2-yl-2,3,4,5-tetrahydroazepine
6-methyl-1-propan-2-yl-2,3,4,5-tetrahydroazepine (PubChem CID 66910914) has the molecular formula C10H19N
and a molecular weight of 153.27 g/mol. Its IUPAC name is 6-methyl-1-propan-2-yl-2,3,4,5-tetrahydroazepine.
Molecular Properties
| Compound Name | 6-methyl-1-propan-2-yl-2,3,4,5-tetrahydroazepine |
| PubChem CID | 66910914 |
| Molecular Formula | C10H19N |
| Molecular Weight | 153.27 g/mol |
| Exact Mass | 153.15 |
| IUPAC Name | 6-methyl-1-propan-2-yl-2,3,4,5-tetrahydroazepine |
| SMILES | CC1=CN(C(C)C)CCCC1 |
| InChI | InChI=1S/C10H19N/c1-9(2)11-7-5-4-6-10(3)8-11/h8-9H,4-7H2,1-3H3 |
| InChIKey | QQTADQKBUPDTCS-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.27 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 6-methyl-1-propan-2-yl-2,3,4,5-tetrahydroazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-1-propan-2-yl-2,3,4,5-tetrahydroazepine?
The IUPAC name of 6-methyl-1-propan-2-yl-2,3,4,5-tetrahydroazepine (CID 66910914) is 6-methyl-1-propan-2-yl-2,3,4,5-tetrahydroazepine.
What is the SMILES notation for 6-methyl-1-propan-2-yl-2,3,4,5-tetrahydroazepine?
The canonical SMILES for 6-methyl-1-propan-2-yl-2,3,4,5-tetrahydroazepine is CC1=CN(C(C)C)CCCC1.
What is the InChIKey of 6-methyl-1-propan-2-yl-2,3,4,5-tetrahydroazepine?
The InChIKey is QQTADQKBUPDTCS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19N/c1-9(2)11-7-5-4-6-10(3)8-11/h8-9H,4-7H2,1-3H3.
What are the key properties of 6-methyl-1-propan-2-yl-2,3,4,5-tetrahydroazepine?
6-methyl-1-propan-2-yl-2,3,4,5-tetrahydroazepine has a molecular weight of 153.27 g/mol, XLogP of 2.78, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-1-propan-2-yl-2,3,4,5-tetrahydroazepine is sourced from PubChem (CID 66910914), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).