About 2-cyclopropyl-N-ethyl-N-methylpyrimidin-4-amine
2-cyclopropyl-N-ethyl-N-methylpyrimidin-4-amine (PubChem CID 66911129) has the molecular formula C10H15N3
and a molecular weight of 177.25 g/mol. Its IUPAC name is 2-cyclopropyl-N-ethyl-N-methylpyrimidin-4-amine.
Molecular Properties
| Compound Name | 2-cyclopropyl-N-ethyl-N-methylpyrimidin-4-amine |
| PubChem CID | 66911129 |
| Molecular Formula | C10H15N3 |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.13 |
| IUPAC Name | 2-cyclopropyl-N-ethyl-N-methylpyrimidin-4-amine |
| SMILES | CCN(C)c1ccnc(C2CC2)n1 |
| InChI | InChI=1S/C10H15N3/c1-3-13(2)9-6-7-11-10(12-9)8-4-5-8/h6-8H,3-5H2,1-2H3 |
| InChIKey | PJMOJRJKHWSRSL-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-cyclopropyl-N-ethyl-N-methylpyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclopropyl-N-ethyl-N-methylpyrimidin-4-amine?
The IUPAC name of 2-cyclopropyl-N-ethyl-N-methylpyrimidin-4-amine (CID 66911129) is 2-cyclopropyl-N-ethyl-N-methylpyrimidin-4-amine.
What is the SMILES notation for 2-cyclopropyl-N-ethyl-N-methylpyrimidin-4-amine?
The canonical SMILES for 2-cyclopropyl-N-ethyl-N-methylpyrimidin-4-amine is CCN(C)c1ccnc(C2CC2)n1.
What is the InChIKey of 2-cyclopropyl-N-ethyl-N-methylpyrimidin-4-amine?
The InChIKey is PJMOJRJKHWSRSL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15N3/c1-3-13(2)9-6-7-11-10(12-9)8-4-5-8/h6-8H,3-5H2,1-2H3.
What are the key properties of 2-cyclopropyl-N-ethyl-N-methylpyrimidin-4-amine?
2-cyclopropyl-N-ethyl-N-methylpyrimidin-4-amine has a molecular weight of 177.25 g/mol, XLogP of 1.81, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclopropyl-N-ethyl-N-methylpyrimidin-4-amine is sourced from PubChem (CID 66911129), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).