About (6-chloro-1H-indol-2-yl) octanoate
(6-chloro-1H-indol-2-yl) octanoate (PubChem CID 66912439) has the molecular formula C16H20ClNO2
and a molecular weight of 293.79 g/mol. Its IUPAC name is (6-chloro-1H-indol-2-yl) octanoate.
Molecular Properties
| Compound Name | (6-chloro-1H-indol-2-yl) octanoate |
| PubChem CID | 66912439 |
| Molecular Formula | C16H20ClNO2 |
| Molecular Weight | 293.79 g/mol |
| Exact Mass | 293.12 |
| IUPAC Name | (6-chloro-1H-indol-2-yl) octanoate |
| SMILES | CCCCCCCC(=O)Oc1cc2ccc(Cl)cc2[nH]1 |
| InChI | InChI=1S/C16H20ClNO2/c1-2-3-4-5-6-7-16(19)20-15-10-12-8-9-13(17)11-14(12)18-15/h8-11,18H,2-7H2,1H3 |
| InChIKey | XWAJOLCUTYBXJD-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 293.79 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (6-chloro-1H-indol-2-yl) octanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-chloro-1H-indol-2-yl) octanoate?
The IUPAC name of (6-chloro-1H-indol-2-yl) octanoate (CID 66912439) is (6-chloro-1H-indol-2-yl) octanoate.
What is the SMILES notation for (6-chloro-1H-indol-2-yl) octanoate?
The canonical SMILES for (6-chloro-1H-indol-2-yl) octanoate is CCCCCCCC(=O)Oc1cc2ccc(Cl)cc2[nH]1.
What is the InChIKey of (6-chloro-1H-indol-2-yl) octanoate?
The InChIKey is XWAJOLCUTYBXJD-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20ClNO2/c1-2-3-4-5-6-7-16(19)20-15-10-12-8-9-13(17)11-14(12)18-15/h8-11,18H,2-7H2,1H3.
What are the key properties of (6-chloro-1H-indol-2-yl) octanoate?
(6-chloro-1H-indol-2-yl) octanoate has a molecular weight of 293.79 g/mol, XLogP of 5.09, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (6-chloro-1H-indol-2-yl) octanoate is sourced from PubChem (CID 66912439), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).