About 2-methoxypentan-3-one;3,5,5-trimethylcyclohex-2-en-1-one
2-methoxypentan-3-one;3,5,5-trimethylcyclohex-2-en-1-one (PubChem CID 66912547) has the molecular formula C15H26O3
and a molecular weight of 254.37 g/mol. Its IUPAC name is 2-methoxypentan-3-one;3,5,5-trimethylcyclohex-2-en-1-one.
Molecular Properties
| Compound Name | 2-methoxypentan-3-one;3,5,5-trimethylcyclohex-2-en-1-one |
| PubChem CID | 66912547 |
| Molecular Formula | C15H26O3 |
| Molecular Weight | 254.37 g/mol |
| Exact Mass | 254.19 |
| IUPAC Name | 2-methoxypentan-3-one;3,5,5-trimethylcyclohex-2-en-1-one |
| SMILES | CC1=CC(=O)CC(C)(C)C1.CCC(=O)C(C)OC |
| InChI | InChI=1S/C9H14O.C6H12O2/c1-7-4-8(10)6-9(2,3)5-7;1-4-6(7)5(2)8-3/h4H,5-6H2,1-3H3;5H,4H2,1-3H3 |
| InChIKey | AWBWONWVVVBXQB-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.37 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-methoxypentan-3-one;3,5,5-trimethylcyclohex-2-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxypentan-3-one;3,5,5-trimethylcyclohex-2-en-1-one?
The IUPAC name of 2-methoxypentan-3-one;3,5,5-trimethylcyclohex-2-en-1-one (CID 66912547) is 2-methoxypentan-3-one;3,5,5-trimethylcyclohex-2-en-1-one.
What is the SMILES notation for 2-methoxypentan-3-one;3,5,5-trimethylcyclohex-2-en-1-one?
The canonical SMILES for 2-methoxypentan-3-one;3,5,5-trimethylcyclohex-2-en-1-one is CC1=CC(=O)CC(C)(C)C1.CCC(=O)C(C)OC.
What is the InChIKey of 2-methoxypentan-3-one;3,5,5-trimethylcyclohex-2-en-1-one?
The InChIKey is AWBWONWVVVBXQB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14O.C6H12O2/c1-7-4-8(10)6-9(2,3)5-7;1-4-6(7)5(2)8-3/h4H,5-6H2,1-3H3;5H,4H2,1-3H3.
What are the key properties of 2-methoxypentan-3-one;3,5,5-trimethylcyclohex-2-en-1-one?
2-methoxypentan-3-one;3,5,5-trimethylcyclohex-2-en-1-one has a molecular weight of 254.37 g/mol, XLogP of 3.32, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxypentan-3-one;3,5,5-trimethylcyclohex-2-en-1-one is sourced from PubChem (CID 66912547), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).